1-(3-(trifluoromethoxy)phenyl)ethanone
$300.00
CAS No.: 170141-63-6
Catalog No.: 190462
Purity: 95%
MF: C9H7F3O2
MW: 204.147
Storage: 2-8 degree Celsius
SMILES: FC(OC=1C=C(C=CC1)C(C)=O)(F)F
Catalog No.: 190462
Purity: 95%
MF: C9H7F3O2
MW: 204.147
Storage: 2-8 degree Celsius
SMILES: FC(OC=1C=C(C=CC1)C(C)=O)(F)F
1-(3-(trifluoromethoxy)phenyl)ethanone; CAS No.: 170141-63-6; 1-(3-(trifluoromethoxy)phenyl)ethanone. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including 1-(3-(trifluoromethoxy)phenyl)ethanone (CAS No.: 170141-63-6). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review