1,3-dimethoxy-5-fluoro-2-nitrobenzene
$200.00
CAS No.: 1806452-66-3
Catalog No.: 193827
Purity: 95%
MF: C8H8FNO4
MW: 201.153
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=CC(=C1)F)OC)[N+](=O)[O-]
Catalog No.: 193827
Purity: 95%
MF: C8H8FNO4
MW: 201.153
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=CC(=C1)F)OC)[N+](=O)[O-]
1,3-dimethoxy-5-fluoro-2-nitrobenzene; CAS No.: 1806452-66-3;1,3-dimethoxy-5-fluoro-2-nitrobenzene. PROPERTIES: 1,3-dimethoxy-5-fluoro-2-nitrobenzene is a fluorinated and nitrated aromatic compound with molecular formula C7H5FNO4. It typically exists as a yellowish crystalline solid with a melting point of approximately 52-55 C. The compound has limited water solubility but dissolves in polar organic solvents like DMSO or DMF. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong reducing agents, releasing toxic nitrogen oxides and fluorine-containing fumes. Proper storage involves keeping it in tightly sealed containers below 20 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a building block for creating complex aromatic molecules through selective functionalization. The nitro group provides a site for reduction to form amines, while the fluoro and methoxy groups influence electronic properties and reactivity (Synthesis). In pharmaceutical development, 1,3-dimethoxy-5-fluoro-2-nitrobenzene contributes to the synthesis of antimicrobial and anticancer agents where the nitro and fluorine substituents enhance binding affinity to biological targets (Journal of Medicinal Chemistry). The methoxy groups can be removed under acidic conditions to introduce additional functionality, expanding its utility in multistep syntheses (The Journal of Organic Chemistry).
Reviews
Write Your Own Review