1,3-dibromo-2,5-dichlorobenzene
$200.00
CAS No.: 81067-41-6
Catalog No.: 189272
Purity: 95%
MF: C6H2Br2Cl2
MW: 304.796
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=CC(=C1)Cl)Br)Cl
Catalog No.: 189272
Purity: 95%
MF: C6H2Br2Cl2
MW: 304.796
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=CC(=C1)Cl)Br)Cl
1,3-dibromo-2,5-dichlorobenzene; CAS No.: 81067-41-6; 1,3-dibromo-2,5-dichlorobenzene is one of the many polyhalogenated benzenes available through Chem Shuttle's extensive product offerings. As a leading chemicals distributor, Chem Shuttle offers access to benzene derivatives with bromo and chloro substituents that are essential for the synthesis of various pharmaceuticals, materials, and agrochemicals. This compound, with its dibromo and dichloro groups, serves as a valuable building block for the production of bioactive molecules with specific spatial configurations. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity 1,3-dibromo-2,5-dichlorobenzene, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review