1,3,5-tribromo-2,4,6-trifluorobenzene
$300.00
CAS No.: 2368-49-2
Catalog No.: 189264
Purity: 95%
MF: C6Br3F3
MW: 368.772
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=C1F)Br)F)Br)F
Catalog No.: 189264
Purity: 95%
MF: C6Br3F3
MW: 368.772
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=C1F)Br)F)Br)F
1,3,5-tribromo-2,4,6-trifluorobenzene; CAS No.: 2368-49-2; 1,3,5-tribromo-2,4,6-trifluorobenzene represents the fully halogenated benzenes category within Chem Shuttle's product range. As a chemical online store, Chem Shuttle provides access to benzene derivatives with multiple bromo and fluoro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its tribromo and trifluoro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized fully halogenated benzenes to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 1,3,5-tribromo-2,4,6-trifluorobenzene, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review