1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone
$200.00
CAS No.: 130336-16-2
Catalog No.: 101890
Purity: 95%
MF: C8H3Cl2F3O
MW: 243.011
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)C(=O)C1=CC(Cl)=CC(Cl)=C1
Catalog No.: 101890
Purity: 95%
MF: C8H3Cl2F3O
MW: 243.011
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)C(=O)C1=CC(Cl)=CC(Cl)=C1
1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone; CAS No.: 130336-16-2; As a worldwide chemical supplier, ChemShuttle offers access to compounds like 1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone. The company's focus on building blocks chemistry supports drug discovery by providing essential intermediates. Researchers can rely on ChemShuttle's comprehensive collection of chemical building blocks, which includes diverse heterocycles and cycle compounds.
Reviews
Write Your Own Review