1-(2-fluoro-4-(trifluoromethyl)phenyl)ethan-1-one
$300.00
CAS No.: 122023-29-4
Catalog No.: 193931
Purity: 95%
MF: C9H6F4O
MW: 206.138
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC(=C1)C(F)(F)F)C(C)=O
Catalog No.: 193931
Purity: 95%
MF: C9H6F4O
MW: 206.138
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC(=C1)C(F)(F)F)C(C)=O
1-(2-fluoro-4-(trifluoromethyl)phenyl)ethan-1-one; CAS No.: 122023-29-4;1-(2-fluoro-4-(trifluoromethyl)phenyl)ethan-1-one. PROPERTIES: 1-(2-fluoro-4-(trifluoromethyl)phenyl)ethan-1-one is a fluorinated and trifluoromethylated aromatic ketone with molecular formula C9H6F4O. It typically exists as a colorless liquid with a boiling point around 140-145 C. The compound has limited water solubility but dissolves well in organic solvents like dichloromethane or THF. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic fluorine-containing fumes. Proper storage involves keeping it in tightly sealed containers below 20 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a versatile intermediate for creating complex aromatic molecules. The fluoro and trifluoromethyl substituents provide strong electron-withdrawing effects that influence reactivity and selectivity, while the ketone group enables nucleophilic addition reactions (The Journal of Organic Chemistry). In pharmaceutical development, 1-(2-fluoro-4-(trifluoromethyl)phenyl)ethan-1-one contributes to the synthesis of antimicrobial agents where the halogenated aromatic scaffold enhances binding to microbial targets (Antimicrobial Agents and Chemotherapy). The compound also finds application in materials science as a building block for organic electronics, where its electron-deficient aromatic core modulates the electronic properties of derived materials (Advanced Materials).
Reviews
Write Your Own Review