1,2-dibromo-4-nitrobenzene
$300.00
CAS No.: 5411-50-7
Catalog No.: 189361
Purity: 95%
MF: C6H3Br2NO2
MW: 280.903
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)[N+](=O)[O-])Br
Catalog No.: 189361
Purity: 95%
MF: C6H3Br2NO2
MW: 280.903
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)[N+](=O)[O-])Br
1,2-dibromo-4-nitrobenzene; CAS No.: 5411-50-7; 1,2-dibromo-4-nitrobenzene is one of the many polyhalogenated nitrobenzenes available through Chem Shuttle's extensive product offerings. As a custom chemical synthesis company, Chem Shuttle specializes in producing benzene derivatives with bromo and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its dibromo and nitro groups, is particularly valuable as a building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's online chemical store provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 1,2-dibromo-4-nitrobenzene is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review