1,2,4-triethoxybenzene
$300.00
CAS No.: 41827-15-0
Catalog No.: 193824
Purity: 95%
MF: C12H18O3
MW: 210.273
Storage: 2-8 degree Celsius
SMILES: C(C)OC1=C(C=C(C=C1)OCC)OCC
Catalog No.: 193824
Purity: 95%
MF: C12H18O3
MW: 210.273
Storage: 2-8 degree Celsius
SMILES: C(C)OC1=C(C=C(C=C1)OCC)OCC
1,2,4-triethoxybenzene; CAS No.: 41827-15-0;1,2,4-triethoxybenzene. PROPERTIES: 1,2,4-triethoxybenzene is a polyether aromatic compound with molecular formula C10H14O3. It typically exists as a colorless liquid with a mild ether-like odor, having a boiling point around 190-195 C. The compound has limited water solubility but dissolves well in organic solvents like ethanol or diethyl ether. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong acids. Proper storage involves keeping it in tightly sealed containers below 20 C, protected from moisture and light. APPLICATIONS: In organic synthesis, this compound serves as a precursor for creating complex aromatic ethers through selective deprotection or cleavage of the ethoxy groups (Synthesis). In materials science, 1,2,4-triethoxybenzene contributes to the development of curable resins and adhesives, where its multiple ether groups enable cross-linking reactions upon exposure to heat or catalysts (Polymer Chemistry). The compound also finds application in the synthesis of organic photovoltaic materials, where its electron-donating ethoxy groups influence the electronic properties of conjugated polymers (Advanced Energy Materials). Its structure allows for facile modification to create materials with tailored optical and electronic characteristics.
Reviews
Write Your Own Review