1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride
$250.00
CAS No.: 1743-01-7
Catalog No.: 102739
Purity: 95%
MF: C10H14ClN
MW: 183.682
Storage: 2-8 degree Celsius
SMILES: Cl[H].NC1CCC2=C(C1)C=CC=C2
Catalog No.: 102739
Purity: 95%
MF: C10H14ClN
MW: 183.682
Storage: 2-8 degree Celsius
SMILES: Cl[H].NC1CCC2=C(C1)C=CC=C2
1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride; CAS No.: 1743-01-7; ChemShuttle, a prominent custom chemical synthesis company, offers a diverse range of chemical building blocks for drug discovery, including 1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride. This compound serves as a crucial intermediate in the synthesis of various pharmaceuticals, particularly in the development of novel antibiotics and other medications. As a chemical online mall, ChemShuttle provides researchers and industries with access to an extensive library of compounds, ensuring they have the necessary resources for their projects. The company's expertise in chemical synthesis and its commitment to quality make it a reliable partner in advancing medical research and chemical applications.
Reviews
Write Your Own Review