1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride
$200.00
CAS No.: 41994-51-8
Catalog No.: 109128
Purity: 95%
MF: C10H12ClNO2
MW: 213.664
Storage: 2-8 degree Celsius
SMILES: Cl.OC(=O)C1CC2=C(CN1)C=CC=C2
Catalog No.: 109128
Purity: 95%
MF: C10H12ClNO2
MW: 213.664
Storage: 2-8 degree Celsius
SMILES: Cl.OC(=O)C1CC2=C(CN1)C=CC=C2
1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride; CAS No.: 41994-51-8; 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride is considered a cycle compound within ChemShuttle's product classification. This designation indicates its role in cyclical chemical processes or as part of a compound library for screening purposes. As a cycle compound, it offers researchers a specific molecular structure that can be incorporated into various synthetic sequences or evaluated in cyclic reaction systems. ChemShuttle's inclusion of 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride in its cycle compounds category reflects the company's understanding of the diverse needs in chemical research. The product's CAS No.: 41994-51-8 enables precise identification and selection among other cycle compounds. By categorizing this compound as a cycle compound, ChemShuttle helps researchers quickly identify chemicals that may be relevant to their cyclical reaction studies or compound screening initiatives. This approach supports efficient research workflows and facilitates the discovery of new chemical entities with desired properties.
Reviews
Write Your Own Review