•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Trifluoromethyls

Set Ascending Direction

   

Items 41 to 50 of 1263 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 5-bromo-3-methoxy-2-(trifluoromethyl)pyridine

    CAS No.: 944805-61-2
    Catalog No.: TQ0036
    Purity: 95%
    MF: C7H5BrF3NO
    MW: 256.021
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C(=NC1)C(F)(F)F)OC
  2. 3-bromo-5-methoxy-2-(trifluoromethyl)pyridine

    CAS No.: 1211589-18-2
    Catalog No.: TQ0037
    Purity: 95%
    MF: C7H5BrF3NO
    MW: 256.021
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC=C(C1)OC)C(F)(F)F
  3. 3-bromo-5-methoxy-4-(trifluoromethyl)pyridine

    CAS No.: 1256807-74-5
    Catalog No.: TQ0038
    Purity: 95%
    MF: C7H5BrF3NO
    MW: 256.021
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NC=C(C1C(F)(F)F)OC
  4. 6-methyl-5-(trifluoromethyl)picolinonitrile

    CAS No.: 1448776-81-5
    Catalog No.: TQ0042
    Purity: 95%
    MF: C8H5F3N2
    MW: 186.136
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=CC(=N1)C#N)C(F)(F)F
  5. methyl 6-methoxy-5-(trifluoromethyl)picolinate

    CAS No.: 1448776-86-0
    Catalog No.: TQ0043
    Purity: 95%
    MF: C9H8F3NO3
    MW: 235.161
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=CC(=N1)C(=O)OC)C(F)(F)F
  6. methyl 6-methoxy-3-(trifluoromethyl)picolinate

    CAS No.: 1448776-87-1
    Catalog No.: TQ0044
    Purity: 95%
    MF: C9H8F3NO3
    MW: 235.161
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C(=N1)C(=O)OC)C(F)(F)F
  7. 6-chloro-5-(trifluoromethyl)picolinonitrile

    CAS No.: 1448776-89-3
    Catalog No.: TQ0046
    Purity: 95%
    MF: C7H2ClF3N2
    MW: 206.554
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC(=N1)C#N)C(F)(F)F
  8. methyl 4-methoxy-5-(trifluoromethyl)picolinate

    CAS No.: 1448776-91-7
    Catalog No.: TQ0048
    Purity: 95%
    MF: C9H8F3NO3
    MW: 235.161
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(=NC=C1C(F)(F)F)C(=O)OC
  9. methyl 4-methoxy-3-(trifluoromethyl)picolinate

    CAS No.: 1448776-92-8
    Catalog No.: TQ0049
    Purity: 95%
    MF: C9H8F3NO3
    MW: 235.161
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C(=NC=C1)C(=O)OC)C(F)(F)F
  10. 2-(3,5-bis(trifluoromethyl)phenyl)ethanamine

    CAS No.: 181772-08-7
    Catalog No.: TQ0094
    Purity: 95%
    MF: C10H9F6N
    MW: 257.177
    Storage: 2-8 degree Celsius
    SMILES: FC(C=1C=C(C=C(C1)C(F)(F)F)CCN)(F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 1263 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7