•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiopyrans

Set Ascending Direction

   

Items 31 to 33 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 4-(aminomethyl)thiochroman-4-ol

    CAS No.: 1528930-01-9
    Catalog No.: TQR1557
    Purity: 95%
    MF: C10H13NOS
    MW: 195.287
    Storage: 2-8 degree Celsius
    SMILES: NCC1(CCSC2=CC=CC=C12)O
  2. 4-(6-hydroxybenzo[d]thiazol-2-yl)tetrahydro-2H-thiopyran-4-aminium chloride

    CAS No.: NA
    Catalog No.: TQR1375
    Purity: 95%
    MF: C12H15ClN2OS2
    MW: 302.852
    Storage: 2-8 degree Celsius
    SMILES: [Cl-].OC1=CC2=C(N=C(S2)C2(CCSCC2)[NH3+])C=C1
  3. 4-vinyltetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide

    CAS No.: 1509910-80-8
    Catalog No.: TQR0317
    Purity: 95%
    MF: C8H12O4S
    MW: 204.247
    Storage: 2-8 degree Celsius
    SMILES: C(=C)C1(CCS(CC1)(=O)=O)C(=O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 33 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4