•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiophenes

Set Ascending Direction

   

Items 31 to 40 of 399 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. N-(3-amino-4-hydroxyphenyl)-5-chlorothiophene-2-sulfonamide

    CAS No.: 2244992-85-4
    Catalog No.: TQR0870
    Purity: 95%
    MF: C10H9ClN2O3S2
    MW: 304.78
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1O)NS(=O)(=O)C=1SC(=CC1)Cl
  2. 2-(3-(((5-cyano-6-oxo-4-(thiophen-2-yl)-1,6-dihydropyrimidin-2-yl)thio)methyl)phenyl)acetic acid

    CAS No.: 1883602-21-8
    Catalog No.: TQR1226
    Purity: 95%
    MF: C18H13N3O3S2
    MW: 383.454
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1=C(N=C(NC1=O)SCC=1C=C(C=CC1)CC(=O)O)C=1SC=CC1
  3. 1-(4-chlorophenyl)-3-(5-phenylthiophen-2-yl)urea

    CAS No.: 2119553-98-7
    Catalog No.: TQR1280
    Purity: 95%
    MF: C17H13ClN2OS
    MW: 328.824
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)NC(=O)NC=1SC(=CC1)C1=CC=CC=C1
  4. 5-phenylthiophen-2-amine

    CAS No.: 14770-85-5
    Catalog No.: TQR1281
    Purity: 95%
    MF: C10H9NS
    MW: 175.256
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=CC=C(S1)N
  5. ethyl 2-amino-4-(3-nitrophenyl)thiophene-3-carboxylate

    CAS No.: 433701-34-9
    Catalog No.: TQR1293
    Purity: 95%
    MF: C13H12N2O4S
    MW: 292.316
    Storage: 2-8 degree Celsius
    SMILES: NC=1SC=C(C1C(=O)OCC)C1=CC(=CC=C1)[N+](=O)[O-]
  6. 2-amino-5-methyl-4-(3-nitrophenyl)thiophene-3-carbonitrile

    CAS No.: 2380023-12-9
    Catalog No.: TQR1294
    Purity: 95%
    MF: C12H9N3O2S
    MW: 259.29
    Storage: 2-8 degree Celsius
    SMILES: NC=1SC(=C(C1C#N)C1=CC(=CC=C1)[N+](=O)[O-])C
  7. (S)-ethyl 2-(N-(2-chloro-6-methylphenyl)thiophene-2-carboxamido)propanoate

    CAS No.: 58184-67-1
    Catalog No.: TQR1371
    Purity: 95%
    MF: C17H18ClNO3S
    MW: 351.855
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=CC=C1)C)N(C(=O)C=1SC=CC1)[C@H](C(=O)OCC)C
  8. 5-(bis(4-chlorophenyl)methyl)-3-methylthiophene-2-carboxylic acid

    CAS No.: 2410959-79-2
    Catalog No.: TQR1432
    Purity: 95%
    MF: C19H14Cl2O2S
    MW: 377.292
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C(C1=CC(=C(S1)C(=O)O)C)C1=CC=C(C=C1)Cl
  9. methyl 3-bromo-4-methylthiophene-2-carboxylate

    CAS No.: 203195-42-0
    Catalog No.: TQR1460
    Purity: 95%
    MF: C7H7BrO2S
    MW: 235.102
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(SC=C1C)C(=O)OC
  10. methyl 5-bromo-4-methyl-3-(4-sulfamoylphenyl)thiophene-2-carboxylate

    CAS No.: 1394374-14-1
    Catalog No.: TQR1461
    Purity: 95%
    MF: C13H12BrNO4S2
    MW: 390.28
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=C(S1)C(=O)OC)C1=CC=C(C=C1)S(N)(=O)=O)C
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 399 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6