•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiophenes

Set Descending Direction

   

Items 21 to 30 of 399 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-morpholino-3-phenethoxythiophene-2-carboxamide

    CAS No.: 2241027-71-2
    Catalog No.: TQR0448
    Purity: 95%
    MF: C17H20N2O3S
    MW: 332.425
    Storage: 2-8 degree Celsius
    SMILES: O1CCN(CC1)C1=CC(=C(S1)C(=O)N)OCCC1=CC=CC=C1
  2. 3-cyclopropylthiophene-2-carbaldehyde

    CAS No.: 29481-31-0
    Catalog No.: TQR0592
    Purity: 95%
    MF: C8H8OS
    MW: 152.218
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=C(SC=C1)C=O
  3. 4-cyclopropylthiophene-2-carbaldehyde

    CAS No.: 893738-62-0
    Catalog No.: TQR0593
    Purity: 95%
    MF: C8H8OS
    MW: 152.218
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1C=C(SC1)C=O
  4. (3-cyclopropylthiophen-2-yl)methanamine

    CAS No.: 1522917-26-5
    Catalog No.: TQR0594
    Purity: 95%
    MF: C8H11NS
    MW: 153.25
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=C(SC=C1)CN
  5. (4-?cyclopropylthiophen-?2-?yl)?methanamine

    CAS No.: 1341913-65-2
    Catalog No.: TQR0595
    Purity: 95%
    MF: C8H11NS
    MW: 153.25
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1C=C(SC1)CN
  6. 3-(5-bromo-2,3-dihydrobenzofuran-7-sulfonamido)thiophene-2-carboxylic acid

    CAS No.: 1268618-43-4
    Catalog No.: TQR0697
    Purity: 95%
    MF: C13H10BrNO5S2
    MW: 404.263
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C2=C(CCO2)C1)S(=O)(=O)NC1=C(SC=C1)C(=O)O
  7. N-(4-bromothiophen-2-yl)-2-(4-(ethylsulfonyl)phenyl)acetamide

    CAS No.: 2101238-59-7
    Catalog No.: TQR0834
    Purity: 95%
    MF: C14H14BrNO3S2
    MW: 388.308
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(SC1)NC(CC1=CC=C(C=C1)S(=O)(=O)CC)=O
  8. 3-hydroxy-2,3-dimethylbutan-2-yl hydrogen (5-(2-(4-(ethylsulfonyl)phenyl)acetamido)thiophen-3-yl)boronate

    CAS No.: 2250418-82-5
    Catalog No.: TQR0835
    Purity: 95%
    MF: C20H28BNO6S2
    MW: 453.391
    Storage: 2-8 degree Celsius
    SMILES: C(C)S(=O)(=O)C1=CC=C(C=C1)CC(=O)NC1=CC(=CS1)B(OC(C)(C(C)(C)O)C)O
  9. 5-(5-aminothiophen-3-yl)-6-(2,2,2-trifluoroethoxy)nicotinonitrile

    CAS No.: 2248670-46-2
    Catalog No.: TQR0837
    Purity: 95%
    MF: C12H8F3N3OS
    MW: 299.277
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC(=CS1)C=1C(=NC=C(C#N)C1)OCC(F)(F)F
  10. 3-(5-aminothiophen-3-yl)-5-fluoro-4-methoxybenzonitrile

    CAS No.: 2250418-86-9
    Catalog No.: TQR0839
    Purity: 95%
    MF: C12H9FN2OS
    MW: 248.282
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC(=CS1)C=1C=C(C#N)C=C(C1OC)F
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 399 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5