•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiophenes

Set Descending Direction

   

Items 11 to 20 of 399 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-bromo-2-methylbenzo[b]thiophene

    CAS No.: 197145-42-9
    Catalog No.: TQP1611
    Purity: 95%
    MF: C9H7BrS
    MW: 227.126
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=CC=2SC(=CC21)C
  2. 5-(thiophen-2-yl)-1H-tetrazole

    CAS No.: 59541-58-1
    Catalog No.: TQR0242
    Purity: 95%
    MF: C5H4N4S
    MW: 152.182
    Storage: 2-8 degree Celsius
    SMILES: S1C(=CC=C1)C1=NN=NN1
  3. N-hydroxy-4-((5-(thiophen-2-yl)-1H-tetrazol-1-yl)methyl)benzamide

    CAS No.: 2247608-27-9
    Catalog No.: TQR0243
    Purity: 95%
    MF: C13H11N5O2S
    MW: 301.331
    Storage: 2-8 degree Celsius
    SMILES: ONC(C1=CC=C(C=C1)CN1N=NN=C1C=1SC=CC1)=O
  4. (S)-3-((tert-butoxycarbonyl)amino)-3-(thiophen-2-yl)propanoic acid

    CAS No.: 500770-66-1
    Catalog No.: TQR0334
    Purity: 95%
    MF: C12H17NO4S
    MW: 271.338
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H](CC(=O)O)C=1SC=CC1
  5. (S)-3-((tert-butoxycarbonyl)amino)-3-(5-methylthiophen-2-yl)propanoic acid

    CAS No.: 1366317-85-2
    Catalog No.: TQR0335
    Purity: 95%
    MF: C13H19NO4S
    MW: 285.365
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H](CC(=O)O)C=1SC(=CC1)C
  6. (S)-3-((tert-butoxycarbonyl)amino)-3-(3-methylthiophen-2-yl)propanoic acid

    CAS No.: 1366396-11-3
    Catalog No.: TQR0336
    Purity: 95%
    MF: C13H19NO4S
    MW: 285.365
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H](CC(=O)O)C=1SC=CC1C
  7. (S)-3-((tert-butoxycarbonyl)amino)-3-(thiophen-3-yl)propanoic acid

    CAS No.: 500770-67-2
    Catalog No.: TQR0338
    Purity: 95%
    MF: C12H17NO4S
    MW: 271.338
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CSC=C1
  8. 3-hydroxy-5-morpholinothiophene-2-carboxamide

    CAS No.: 2241409-07-2
    Catalog No.: TQR0445
    Purity: 95%
    MF: C9H12N2O3S
    MW: 228.273
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(SC(=C1)N1CCOCC1)C(=O)N
  9. methyl 5-iodo-3-phenethoxythiophene-2-carboxylate

    CAS No.: 2241027-73-4
    Catalog No.: TQR0446
    Purity: 95%
    MF: C14H13IO3S
    MW: 388.226
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC(=C(S1)C(=O)OC)OCCC1=CC=CC=C1
  10. 5-morpholino-3-(4-(trifluoromethoxy)phenethoxy)thiophene-2-carboxamide

    CAS No.: 2241409-18-5
    Catalog No.: TQR0447
    Purity: 95%
    MF: C18H19F3N2O4S
    MW: 416.421
    Storage: 2-8 degree Celsius
    SMILES: O1CCN(CC1)C1=CC(=C(S1)C(=O)N)OCCC1=CC=C(C=C1)OC(F)(F)F
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 399 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5