•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thienopyrimidines

Set Ascending Direction

   

Items 1 to 10 of 117 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-bromo-4-chloro-6-ethylthieno[2,3-d]pyrimidine

    CAS No.: 2101206-37-3
    Catalog No.: TQR0157
    Purity: 95%
    MF: C8H6BrClN2S
    MW: 277.574
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(SC=2N=CN=C(C21)Cl)CC
  2. 4-chloro-6-ethyl-5-iodo-2-(methylthio)thieno[2,3-d]pyrimidine

    CAS No.: 2375543-84-1
    Catalog No.: TQR0158
    Purity: 95%
    MF: C9H8ClIN2S2
    MW: 370.668
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=C(N1)SC)SC(=C2I)CC
  3. 4-chloro-6-ethyl-5-iodothieno[2,3-d]pyrimidine

    CAS No.: 1799610-93-7
    Catalog No.: TQR0159
    Purity: 95%
    MF: C8H6ClIN2S
    MW: 324.574
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)SC(=C2I)CC
  4. 6-iodothieno[2,3-d]pyrimidin-4(3H)-one

    CAS No.: 1378867-62-9
    Catalog No.: TQR0160
    Purity: 95%
    MF: C6H3IN2OS
    MW: 278.074
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC2=C(N=CNC2=O)S1
  5. 4-chloro-6-iodothieno[2,3-d]pyrimidine

    CAS No.: 552295-08-6
    Catalog No.: TQR0161
    Purity: 95%
    MF: C6H2ClIN2S
    MW: 296.52
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)SC(=C2)I
  6. 5-bromo-4-chloro-6-iodothieno[2,3-d]pyrimidine

    CAS No.: 1799610-89-1
    Catalog No.: TQR0162
    Purity: 95%
    MF: C6HBrClIN2S
    MW: 375.416
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(SC=2N=CN=C(C21)Cl)I
  7. 2-(methylthio)thieno[2,3-d]pyrimidin-4-amine

    CAS No.: 87492-76-0
    Catalog No.: TQR0403
    Purity: 95%
    MF: C7H7N3S2
    MW: 197.288
    Storage: 2-8 degree Celsius
    SMILES: CSC=1N=C(C2=C(N1)SC=C2)N
  8. tetraethyl (((2-(methylthio)thieno[2,3-d]pyrimidin-4-yl)amino)methylene)bis(phosphonate)

    CAS No.: 2241548-24-1
    Catalog No.: TQR0404
    Purity: 95%
    MF: C16H27N3O6P2S2
    MW: 483.489
    Storage: 2-8 degree Celsius
    SMILES: CSC=1N=C(C2=C(N1)SC=C2)NC(P(OCC)(OCC)=O)P(OCC)(OCC)=O
  9. tetraethyl (((2-(3-aminophenyl)thieno[2,3-d]pyrimidin-4-yl)amino)methylene)bis(phosphonate)

    CAS No.: 2241548-28-5
    Catalog No.: TQR0405
    Purity: 95%
    MF: C21H30N4O6P2S
    MW: 528.508
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1)C=1N=C(C2=C(N1)SC=C2)NC(P(OCC)(OCC)=O)P(OCC)(OCC)=O
  10. 3-phenyl-2-thioxo-2,3,6,7-tetrahydrothieno[3,2-d]pyrimidin-4(1H)-one

    CAS No.: 1022363-09-2
    Catalog No.: TQR0682
    Purity: 95%
    MF: C12H10N2OS2
    MW: 262.359
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)N1C(NC2=C(C1=O)SCC2)=S
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 117 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5