•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazolopyridines

Set Ascending Direction

   

Items 11 to 20 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 4-bromo-7-methylisothiazolo[4,5-c]pyridine

    CAS No.: 2255-80-3
    Catalog No.: 102164
    Purity: 95%
    MF: C7H5BrN2S
    MW: 229.102
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN=C(Br)C2=C1SN=C2
  2. thiazolo[5,4-b]pyridin-2-amine

    CAS No.: 31784-70-0
    Catalog No.: 104305
    Purity: 95%
    MF: C6H5N3S
    MW: 151.194
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=CC=CN=C2S1
  3. 2-bromothiazolo[5,4-b]pyridine

    CAS No.: 412923-40-1
    Catalog No.: 104306
    Purity: 95%
    MF: C6H3BrN2S
    MW: 215.075
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NC2=CC=CN=C2S1
  4. 4-chloro-2-(2-chloro-6-fluorophenyl)thiazolo[5,4-c]pyridine

    CAS No.: 1242249-93-9
    Catalog No.: 104675
    Purity: 95%
    MF: C12H5Cl2FN2S
    MW: 299.157
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C2=NC3=C(S2)C(Cl)=NC=C3)C(Cl)=CC=C1
  5. tert-butyl 2-amino-6,7-dihydrothiazolo[5,4-c]pyridine-5(4H)-carboxylate

    CAS No.: 365996-05-0
    Catalog No.: 104963
    Purity: 95%
    MF: C11H17N3O2S
    MW: 255.343
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCC2=C(C1)SC(N)=N2
  6. tert-butyl 2-bromo-6,7-dihydrothiazolo[5,4-c]pyridine-5(4H)-carboxylate

    CAS No.: 365996-06-1
    Catalog No.: 105499
    Purity: 95%
    MF: C11H15BrN2O2S
    MW: 319.224
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCC2=C(C1)SC(Br)=N2
  7. thiazolo[5,4-c]pyridine

    CAS No.: 273-70-1
    Catalog No.: 110065
    Purity: 95%
    MF: C6H4N2S
    MW: 136.179
    Storage: 2-8 degree Celsius
    SMILES: S1C=NC2=C1C=NC=C2
  8. 5-bromo-thiazolo[5,4-b]pyridin-2-ylamine

    CAS No.: 934266-82-7
    Catalog No.: WLZ2303
    Purity: 95%
    MF: C6H4BrN3S
    MW: 230.09
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C(=N1)SC(=N2)N
  9. 6-bromothiazolo[4,5-b]pyridine

    CAS No.: 1264193-12-5
    Catalog No.: 192541
    Purity: 95%
    MF: C6H3BrN2S
    MW: 215.075
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=NC1)N=CS2
  10. 3,6-dibromoisothiazolo[4,3-b]pyridine

    CAS No.: 1643854-33-4
    Catalog No.: TQR0509
    Purity: 95%
    MF: C6H2Br2N2S
    MW: 293.971
    Storage: 2-8 degree Celsius
    SMILES: BrC=1SN=C2C1N=CC(=C2)Br
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4