•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazoles

Set Ascending Direction

   

Items 11 to 20 of 349 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-(2-chloropyrimidin-4-yl)-4-(4-fluorophenyl)thiazol-2-amine

    CAS No.: 2380029-43-4
    Catalog No.: TQR1191
    Purity: 95%
    MF: C13H8ClFN4S
    MW: 306.753
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC(=N1)C1=C(N=C(S1)N)C1=CC=C(C=C1)F
  2. tert-butyl 4-(5-bromothiazol-2-yl)piperidine-1-carboxylate

    CAS No.: 951259-16-8
    Catalog No.: TQR1192
    Purity: 95%
    MF: C13H19BrN2O2S
    MW: 347.278
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CN=C(S1)C1CCN(CC1)C(=O)OC(C)(C)C
  3. tert-butyl 4-(4-bromothiazol-2-yl)piperidine-1-carboxylate

    CAS No.: 1211538-88-3
    Catalog No.: TQR1195
    Purity: 95%
    MF: C13H19BrN2O2S
    MW: 347.278
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C(SC1)C1CCN(CC1)C(=O)OC(C)(C)C
  4. tert-butyl (2,4-difluorophenyl)sulfonyl(thiazol-4-yl)carbamate

    CAS No.: 1632256-89-3
    Catalog No.: TQR1255
    Purity: 95%
    MF: C14H14F2N2O4S2
    MW: 376.406
    Storage: 2-8 degree Celsius
    SMILES: O=C(OC(C)(C)C)N(S(=O)(C1=CC=C(F)C=C1F)=O)C2=CSC=N2
  5. tert-butyl thiazol-4-yl((2,4,5-trifluorophenyl)sulfonyl)carbamate

    CAS No.: 1235406-62-8
    Catalog No.: TQR1256
    Purity: 95%
    MF: C14H13F3N2O4S2
    MW: 394.396
    Storage: 2-8 degree Celsius
    SMILES: S1C=NC(=C1)N(C(OC(C)(C)C)=O)S(=O)(=O)C1=C(C=C(C(=C1)F)F)F
  6. (S)-methyl 6-(bromomethyl)-4-(4-chloro-3-fluorophenyl)-2-(thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate

    CAS No.: 1638652-89-7
    Catalog No.: TQR1351
    Purity: 95%
    MF: C16H12BrClFN3O2S
    MW: 444.713
    Storage: 2-8 degree Celsius
    SMILES: BrCC1=C([C@@H](N=C(N1)C=1SC=CN1)C1=CC(=C(C=C1)Cl)F)C(=O)OC
  7. 2-((4-chloro-3,5-difluorophenyl)amino)-N-(3-isopropoxypropyl)thiazole-4-carboxamide

    CAS No.: 2459658-45-6
    Catalog No.: TQR1402
    Purity: 95%
    MF: C16H18ClF2N3O2S
    MW: 389.855
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1F)NC=1SC=C(N1)C(=O)NCCCOC(C)C)F
  8. 5-cyclopropyl-5'-phenyl-[2,2'-bithiazole]-4-carboxylic acid

    CAS No.: 2194550-09-7
    Catalog No.: TQR1457
    Purity: 95%
    MF: C16H12N2O2S2
    MW: 328.418
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=C(N=C(S1)C=1SC(=CN1)C1=CC=CC=C1)C(=O)O
  9. (5-((3-ethyl-5-(1-methyl-1H-pyrazol-4-yl)phenyl)sulfonyl)thiazol-2-yl)methanamine

    CAS No.: 2126134-76-5
    Catalog No.: TQR1562
    Purity: 95%
    MF: C16H18N4O2S2
    MW: 362.48
    Storage: 2-8 degree Celsius
    SMILES: C(C)C=1C=C(C=C(C1)C=1C=NN(C1)C)S(=O)(=O)C1=CN=C(S1)CN
  10. 2-(thiazol-2-yl)but-3-yn-2-ol

    CAS No.: 1202769-68-3
    Catalog No.: TQR1819
    Purity: 95%
    MF: C7H7NOS
    MW: 153.206
    Storage: 2-8 degree Celsius
    SMILES: S1C(=NC=C1)C(C)(C#C)O
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 349 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5