•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazoles

Set Ascending Direction

   

Items 41 to 50 of 349 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 3-methylisothiazol-5-amine hydrochloride

    CAS No.: 52547-00-9
    Catalog No.: 110297
    Purity: 95%
    MF: C4H7ClN2S
    MW: 150.634
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CC1=NSC(N)=C1
  2. 2,4-dichloro-thiazole

    CAS No.: 4175-76-2
    Catalog No.: 111019
    Purity: 95%
    MF: C3HCl2NS
    MW: 154.021
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(Cl)=CS1
  3. 2-bromothiazole-4-carboxylic acid

    CAS No.: 5198-88-9
    Catalog No.: 112137
    Purity: 95%
    MF: C4H2BrNO2S
    MW: 208.036
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CSC(Br)=N1
  4. 2,4-dibromothiazole

    CAS No.: 4175-77-3
    Catalog No.: 112704
    Purity: 95%
    MF: C3HBr2NS
    MW: 242.923
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NC(Br)=CS1
  5. 5-bromothiazole-4-carboxylic acid

    CAS No.: 103878-58-6
    Catalog No.: 113977
    Purity: 95%
    MF: C4H2BrNO2S
    MW: 208.036
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=C(Br)SC=N1
  6. 2-amino-1,3-thiazole-5-carboxylic acid

    CAS No.: 40283-46-3
    Catalog No.: 122570
    Purity: 95%
    MF: C4H4N2O2S
    MW: 144.155
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(S1)C(O)=O
  7. 4-bromo-2-(tributylstannyl)-1,3-thiazole

    CAS No.: 173978-98-8
    Catalog No.: 124284
    Purity: 95%
    MF: C15H28BrNSSn
    MW: 453.078
    Storage: 2-8 degree Celsius
    SMILES: CCCC[Sn](CCCC)(CCCC)C1=NC(Br)=CS1
  8. 5-(bromomethyl)thiazole

    CAS No.: 167998-61-0
    Catalog No.: 129087
    Purity: 95%
    MF: C4H4BrNS
    MW: 178.054
    Storage: 2-8 degree Celsius
    SMILES: BrCC1=CN=CS1
  9. 2,4-dimethylthiazole

    CAS No.: 541-58-2
    Catalog No.: 129730
    Purity: 95%
    MF: C5H7NS
    MW: 113.185
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC(C)=CS1
  10. (2,4-dimethylthiazol-5-yl)methanol

    CAS No.: 50382-32-6
    Catalog No.: 131102
    Purity: 95%
    MF: C6H9NOS
    MW: 143.211
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC(C)=C(CO)S1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 349 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7