•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazoles

Set Descending Direction

   

Items 1 to 10 of 349 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-cyclopropylthiazole

    CAS No.: 433217-34-6
    Catalog No.: 193313
    Purity: 95%
    MF: C6H7NS
    MW: 125.196
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1N=CSC1
  2. 6-bromo-5-fluorobenzo[d]thiazol-2-amine

    CAS No.: 1022151-32-1
    Catalog No.: TQ0015
    Purity: 95%
    MF: C7H4BrFN2S
    MW: 247.092
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=C(S2)N)C=C1F
  3. 4-amino-2-(benzylthio)thiazole-5-carbonitrile

    CAS No.: 39736-35-1
    Catalog No.: TQ0123
    Purity: 95%
    MF: C11H9N3S2
    MW: 247.348
    Storage: 2-8 degree Celsius
    SMILES: NC=1N=C(SC1C#N)SCC1=CC=CC=C1
  4. tert-butyl 2-((tert-butoxycarbonyl)(4-(hydroxymethyl)thiazol-2-yl)amino)acetate

    CAS No.: 2244586-46-5
    Catalog No.: TQR0415
    Purity: 95%
    MF: C15H24N2O5S
    MW: 344.433
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N(CC(=O)OC(C)(C)C)C=1SC=C(N1)CO
  5. (S)-N-(5-(7-chloro-2-(1-cyclopropylethyl)-1-oxoisoindolin-5-yl)-4-methylthiazol-2-yl)acetamide

    CAS No.: 2132961-83-0
    Catalog No.: TQR0636
    Purity: 95%
    MF: C19H20ClN3O2S
    MW: 389.908
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=C2CN(C(C12)=O)[C@@H](C)C1CC1)C1=C(N=C(S1)NC(C)=O)C
  6. (S)-N-(5-(2-(1-cyclopropylethyl)-7-(methylsulfonyl)-1-oxoisoindolin-5-yl)-4-methylthiazol-2-yl)acetamide

    CAS No.: 2132961-46-5
    Catalog No.: TQR0637
    Purity: 95%
    MF: C20H23N3O4S2
    MW: 433.555
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)[C@H](C)N1C(C2=C(C=C(C=C2C1)C1=C(N=C(S1)NC(C)=O)C)S(=O)(=O)C)=O
  7. 2-(4-(chloromethyl)phenyl)thiazole

    CAS No.: 906352-61-2
    Catalog No.: TQR0776
    Purity: 95%
    MF: C10H8ClNS
    MW: 209.701
    Storage: 2-8 degree Celsius
    SMILES: ClCC1=CC=C(C=C1)C=1SC=CN1
  8. (R)-ethyl 4-(2-bromo-4-fluorophenyl)-6-methyl-2-(thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate

    CAS No.: 1345097-86-0
    Catalog No.: TQR1022
    Purity: 95%
    MF: C17H15BrFN3O2S
    MW: 424.295
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC(=C1)F)[C@@H]1N=C(NC(=C1C(=O)OCC)C)C=1SC=CN1
  9. ethyl 4-(2-bromo-4-fluorophenyl)-6-methyl-2-(thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate

    CAS No.: 1092952-98-1
    Catalog No.: TQR1023
    Purity: 95%
    MF: C17H15BrFN3O2S
    MW: 424.295
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC(=C1)F)C1N=C(NC(=C1C(=O)OCC)C)C=1SC=CN1
  10. 2-chloro-4-(4-fluorophenyl)-5-(2-(methylthio)pyrimidin-4-yl)thiazole

    CAS No.: 917808-23-2
    Catalog No.: TQR1190
    Purity: 95%
    MF: C14H9ClFN3S2
    MW: 337.832
    Storage: 2-8 degree Celsius
    SMILES: ClC=1SC(=C(N1)C1=CC=C(C=C1)F)C1=NC(=NC=C1)SC
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 349 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5