•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetrazines

Set Ascending Direction

   

Items 31 to 34 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. (4-(1,2,4,5-tetrazin-3-yl)phenyl)methanamine

    CAS No.: 1092689-33-2
    Catalog No.: HKP0312
    Purity: 95%
    MF: C9H9N5
    MW: 187.206
    Storage: 2-8 degree Celsius
    SMILES: N1=NC(=NN=C1)C1=CC=C(C=C1)CN
  2. 2-(4-(1,2,4,5-tetrazin-3-yl)phenyl)acetic acid

    CAS No.: 1380500-92-4
    Catalog No.: HKP0313
    Purity: 95%
    MF: C10H8N4O2
    MW: 216.2
    Storage: 2-8 degree Celsius
    SMILES: N1=NC(=NN=C1)C1=CC=C(C=C1)CC(=O)O
  3. (4-(1,2,4,5-tetrazin-3-yl)phenyl)methanol

    CAS No.: 1225146-54-2
    Catalog No.: HKP0314
    Purity: 95%
    MF: C9H8N4O
    MW: 188.19
    Storage: 2-8 degree Celsius
    SMILES: N1=NC(=NN=C1)C1=CC=C(C=C1)CO
  4. 3-methyl-6-(pyridin-2-yl)-1,2,4,5-tetrazine

    CAS No.: 57537-63-0
    Catalog No.: TQP1081
    Purity: 95%
    MF: C8H7N5
    MW: 173.179
    Storage: 2-8 degree Celsius
    SMILES: CC=1N=NC(=NN1)C1=NC=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 34 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4