•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonylfluorides

Set Descending Direction

   

Items 1 to 10 of 11 total

  1. 1
  2. 2
  1. morpholine-4-sulfonyl fluoride

    CAS No.: 63698-84-0
    Catalog No.: 186030
    Purity: 95%
    MF: C4H8FNO3S
    MW: 169.177
    Storage: 2-8 degree Celsius
    SMILES: N1(CCOCC1)S(=O)(=O)F
  2. piperidine-1-sulfonyl fluoride

    CAS No.: 63698-83-9
    Catalog No.: 186031
    Purity: 95%
    MF: C5H10FNO2S
    MW: 167.205
    Storage: 2-8 degree Celsius
    SMILES: N1(CCCCC1)S(=O)(=O)F
  3. 2-bromo-4-methylbenzene-1-sulfonyl fluoride

    CAS No.: 320-61-6
    Catalog No.: TQP2118
    Purity: 95%
    MF: C7H6BrFO2S
    MW: 253.092
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC(=C1)C)S(=O)(=O)F
  4. 4-bromo-2-fluorobenzene-1-sulfonyl fluoride

    CAS No.: 1396779-67-1
    Catalog No.: TQP2119
    Purity: 95%
    MF: C6H3BrF2O2S
    MW: 257.055
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=C(C=C1)S(=O)(=O)F)F
  5. 4-bromo-3-methylbenzene-1-sulfonyl fluoride

    CAS No.: 1030832-29-1
    Catalog No.: TQP2120
    Purity: 95%
    MF: C7H6BrFO2S
    MW: 253.092
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C=C1)S(=O)(=O)F)C
  6. 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1-sulfonyl fluoride

    CAS No.: 2088829-16-5
    Catalog No.: TQP2121
    Purity: 95%
    MF: C12H15BBrFO4S
    MW: 365.029
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=C(C1)B1OC(C(O1)(C)C)(C)C)S(=O)(=O)F
  7. 1-(fluorosulfonyl)-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate

    CAS No.: 2179072-33-2
    Catalog No.: 185051
    Purity: 95%
    MF: C6H8F4N2O5S2
    MW: 328.265
    Storage: -20 degree Celsius
    SMILES: [O-]S(=O)(=O)C(F)(F)F.CC1=[N+](C)C=CN1S(F)(=O)=O
  8. 3-bromobenzenesulfonyl fluoride

    CAS No.: 454-65-9
    Catalog No.: 189022
    Purity: 95%
    MF: C6H4BrFO2S
    MW: 239.065
    Storage: -20 degree Celsius
    SMILES: BrC=1C=C(C=CC1)S(=O)(=O)F
  9. 3,4-dimethoxybenzene-1-sulfonylfluoride

    CAS No.: 95546-50-2
    Catalog No.: WLZ2570
    Purity: 95%
    MF: C8H9FO4S
    MW: 220.221
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C(C=CC1OC)S(=O)(=O)F
  10. 3-carbamoylbenzene-1-sulfonylfluoride

    CAS No.: 454-94-4
    Catalog No.: WLZ2694
    Purity: 95%
    MF: C7H6FNO3S
    MW: 203.194
    Storage: 2-8 degree Celsius
    SMILES: C(N)(=O)C=1C=C(C=CC1)S(=O)(=O)F
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 11 total

  1. 1
  2. 2