•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonamide

Set Descending Direction

   

Items 51 to 60 of 460 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 2-chloro-N-cyclopropyl-5-(hydroxymethyl)benzenesulfonamide

    CAS No.: 1186518-72-8
    Catalog No.: TQR1619
    Purity: 95%
    MF: C10H12ClNO3S
    MW: 261.73
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)CO)S(=O)(=O)NC1CC1
  2. 2-bromo-N,N-dimethyl-5-nitrobenzenesulfonamide

    CAS No.: 2459251-28-4
    Catalog No.: TQR1620
    Purity: 95%
    MF: C8H9BrN2O4S
    MW: 309.141
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N(C)C
  3. 2-iodo-N,N-dimethyl-5-nitrobenzenesulfonamide

    CAS No.: 2459251-29-5
    Catalog No.: TQR1621
    Purity: 95%
    MF: C8H9IN2O4S
    MW: 356.141
    Storage: 2-8 degree Celsius
    SMILES: IC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N(C)C
  4. N,N-dimethyl-5-nitro-2-(trifluoromethyl)benzenesulfonamide

    CAS No.: 2459251-32-0
    Catalog No.: TQR1622
    Purity: 95%
    MF: C9H9F3N2O4S
    MW: 298.242
    Storage: 2-8 degree Celsius
    SMILES: CN(S(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])C(F)(F)F)C
  5. N-(6-(2,4-difluorophenoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)methanesulfonamide

    CAS No.: 2411228-11-8
    Catalog No.: TQR1739
    Purity: 95%
    MF: C18H21BF2N2O5S
    MW: 426.25
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(OC2=C(C=C(C=N2)NS(=O)(=O)C)B2OC(C(O2)(C)C)(C)C)C=CC(=C1)F
  6. N-(6-(2,4-difluorophenoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)ethanesulfonamide

    CAS No.: 1706752-08-0
    Catalog No.: TQR1740
    Purity: 95%
    MF: C19H23BF2N2O5S
    MW: 440.277
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(OC2=C(C=C(C=N2)NS(=O)(=O)CC)B2OC(C(O2)(C)C)(C)C)C=CC(=C1)F
  7. N-(2,4-difluoro-3-iodophenyl)propane-1-sulfonamide

    CAS No.: 1392429-92-3
    Catalog No.: TQR1753
    Purity: 95%
    MF: C9H10F2INO2S
    MW: 361.151
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=CC(=C1I)F)NS(=O)(=O)CCC
  8. (E)-4-((4-((4-(4-(2-cyanovinyl)-2,6-dimethylphenoxy)thieno[2,3-d]pyrimidin-2-yl)amino)piperidin-1-yl)methyl)benzenesulfonamide

    CAS No.: 2415256-47-0
    Catalog No.: TQR1842
    Purity: 95%
    MF: C29H30N6O3S2
    MW: 574.732
    Storage: 2-8 degree Celsius
    SMILES: C(#N)/C=C/C1=CC(=C(OC=2C3=C(N=C(N2)NC2CCN(CC2)CC2=CC=C(C=C2)S(=O)(=O)N)SC=C3)C(=C1)C)C
  9. (S)-3-methyl-2-(4-methylphenylsulfonamido)butanoic acid

    CAS No.: 17360-25-7
    Catalog No.: TQR1857
    Purity: 95%
    MF: C12H17NO4S
    MW: 271.338
    Storage: 2-8 degree Celsius
    SMILES: CC([C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)C)C
  10. (R)-3-methyl-2-(4-methylphenylsulfonamido)butanoic acid

    CAS No.: 68005-71-0
    Catalog No.: TQR1858
    Purity: 95%
    MF: C12H17NO4S
    MW: 271.338
    Storage: 2-8 degree Celsius
    SMILES: CC(C)[C@@H](NS(=O)(C1=CC=C(C)C=C1)=O)C(O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 51 to 60 of 460 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8