•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonamide

Set Descending Direction

   

Items 21 to 30 of 460 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. N-(3-amino-4-hydroxyphenyl)-5-chlorothiophene-2-sulfonamide

    CAS No.: 2244992-85-4
    Catalog No.: TQR0870
    Purity: 95%
    MF: C10H9ClN2O3S2
    MW: 304.78
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1O)NS(=O)(=O)C=1SC(=CC1)Cl
  2. N-(2-(4-aminophenyl)benzo[d]oxazol-5-yl)-5-chlorothiophene-2-sulfonamide

    CAS No.: 2247719-92-0
    Catalog No.: TQR0871
    Purity: 95%
    MF: C17H12ClN3O3S2
    MW: 405.888
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=C1)C=1OC2=C(N1)C=C(C=C2)NS(=O)(=O)C=2SC(=CC2)Cl
  3. N-(4-(5-aminobenzo[d]oxazol-2-yl)phenyl)-5-chlorothiophene-2-sulfonamide

    CAS No.: 2244991-97-5
    Catalog No.: TQR0872
    Purity: 95%
    MF: C17H12ClN3O3S2
    MW: 405.888
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=CC2=C(N=C(O2)C2=CC=C(C=C2)NS(=O)(=O)C=2SC(=CC2)Cl)C1
  4. 2,4-difluoro-N-(2-methoxy-5-(4-methyl-8-((3-methyloxetan-3-yl)methoxy)quinazolin-6-yl)pyridin-3-yl)benzenesulfonamide

    CAS No.: 2231399-62-3
    Catalog No.: TQR1145
    Purity: 95%
    MF: C26H24F2N4O5S
    MW: 542.564
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=CC(=C1)F)S(=O)(=O)NC=1C(=NC=C(C1)C=1C=C2C(=NC=NC2=C(C1)OCC1(COC1)C)C)OC
  5. 3-chloro-N-(2,4-dimethoxybenzyl)-4-fluoro-N-(thiazol-2-yl)benzenesulfonamide

    CAS No.: 1788874-32-7
    Catalog No.: TQR1252
    Purity: 95%
    MF: C18H16ClFN2O4S2
    MW: 442.921
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=CC1F)S(=O)(=O)N(C=1SC=CN1)CC1=C(C=C(C=C1)OC)OC
  6. 5-chloro-N-(2,4-dimethoxybenzyl)-2,4-difluoro-N-(5-fluorothiazol-2-yl)benzenesulfonamide

    CAS No.: 1788874-30-5
    Catalog No.: TQR1254
    Purity: 95%
    MF: C18H14ClF3N2O4S2
    MW: 478.901
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=CC(=C(C1)S(=O)(=O)N(C=1SC(=CN1)F)CC1=C(C=C(C=C1)OC)OC)F)F
  7. N,N-dimethyl-3-(2-methyl-1H-indol-3-yl)benzenesulfonamide

    CAS No.: 2125957-05-1
    Catalog No.: TQR1285
    Purity: 95%
    MF: C17H18N2O2S
    MW: 314.41
    Storage: 2-8 degree Celsius
    SMILES: CN(S(=O)(=O)C1=CC(=CC=C1)C1=C(NC2=CC=CC=C12)C)C
  8. 5-(azepan-1-ylsulfonyl)-2-methoxyaniline

    CAS No.: 568551-66-6
    Catalog No.: TQR1364
    Purity: 95%
    MF: C13H20N2O3S
    MW: 284.381
    Storage: 2-8 degree Celsius
    SMILES: N1(CCCCCC1)S(=O)(=O)C=1C=CC(=C(N)C1)OC
  9. 5-amino-2-(3-chlorophenoxy)-N-(2,4-dimethoxybenzyl)benzenesulfonamide

    CAS No.: 2055604-10-7
    Catalog No.: TQR1393
    Purity: 95%
    MF: C21H21ClN2O5S
    MW: 448.928
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=CC(=C(C1)S(=O)(=O)NCC1=C(C=C(C=C1)OC)OC)OC1=CC(=CC=C1)Cl
  10. 2-chloro-N-(2,4-dimethoxybenzyl)-5-nitrobenzenesulfonamide

    CAS No.: 2055603-36-4
    Catalog No.: TQR1395
    Purity: 95%
    MF: C15H15ClN2O6S
    MW: 386.813
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)NCC1=C(C=C(C=C1)OC)OC
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 460 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5