•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Sulfonamide

Set Ascending Direction

   

Items 11 to 20 of 460 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (R)-N,3-dimethyl-N-(4-(4-methylpiperidin-1-yl)butan-2-yl)benzenesulfonamide

    CAS No.: 195199-95-2
    Catalog No.: TQP0829
    Purity: 95%
    MF: C18H30N2O2S
    MW: 338.517
    Storage: 2-8 degree Celsius
    SMILES: CN(S(=O)(=O)C1=CC(=CC=C1)C)[C@H](C)CCN1CCC(CC1)C
  2. 2-amino-4-(azepan-1-ylsulfonyl)phenol

    CAS No.: 1036594-72-5
    Catalog No.: TQR0235
    Purity: 95%
    MF: C12H18N2O3S
    MW: 270.354
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=CC(=C1)S(=O)(=O)N1CCCCCC1)O
  3. 3-amino-4-methoxy-N-methylbenzenesulfonamide

    CAS No.: 99969-26-3
    Catalog No.: TQR0236
    Purity: 95%
    MF: C8H12N2O3S
    MW: 216.262
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1OC)S(=O)(=O)NC
  4. 5-(azepan-1-ylsulfonyl)-2-methylaniline

    CAS No.: 1017390-36-1
    Catalog No.: TQR0237
    Purity: 95%
    MF: C13H20N2O2S
    MW: 268.382
    Storage: 2-8 degree Celsius
    SMILES: N1(CCCCCC1)S(=O)(=O)C=1C=CC(=C(N)C1)C
  5. 3-(azepan-1-ylsulfonyl)aniline

    CAS No.: 91619-39-5
    Catalog No.: TQR0238
    Purity: 95%
    MF: C12H18N2O2S
    MW: 254.355
    Storage: 2-8 degree Celsius
    SMILES: N1(CCCCCC1)S(=O)(=O)C=1C=C(N)C=CC1
  6. 3-(benzylamino)-4-(cyclohexylamino)-N-(2-(piperazin-1-yl)ethyl)benzenesulfonamide hydrochloride

    CAS No.: 2271358-65-5
    Catalog No.: TQR0284
    Purity: 95%
    MF: C25H38ClN5O2S
    MW: 508.132
    Storage: 2-8 degree Celsius
    SMILES: Cl.C(C1=CC=CC=C1)NC=1C=C(C=CC1NC1CCCCC1)S(=O)(=O)NCCN1CCNCC1
  7. 2,4-difluoro-N-(3-fluoro-4-((6-methoxy-7-(3-(3-methylpiperidin-1-yl)propoxy)quinolin-4-yl)oxy)phenyl)benzenesulfonamide

    CAS No.: 1292258-53-7
    Catalog No.: TQR0530
    Purity: 95%
    MF: C31H32F3N3O5S
    MW: 615.674
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=CC(=C1)F)S(=O)(=O)NC1=CC(=C(C=C1)OC1=CC=NC2=CC(=C(C=C12)OC)OCCCN1CC(CCC1)C)F
  8. 4-((5-oxo-7-phenyl-5,6,7,8-tetrahydroquinazolin-2-yl)amino)benzenesulfonamide

    CAS No.: 2237226-41-2
    Catalog No.: TQR0571
    Purity: 95%
    MF: C20H18N4O3S
    MW: 394.456
    Storage: 2-8 degree Celsius
    SMILES: O=C1C=2C=NC(=NC2CC(C1)C1=CC=CC=C1)NC1=CC=C(C=C1)S(=O)(=O)N
  9. 4-(2-aminoethyl)-N-methylbenzenesulfonamide

    CAS No.: 223253-76-7
    Catalog No.: TQR0629
    Purity: 95%
    MF: C9H14N2O2S
    MW: 214.29
    Storage: 2-8 degree Celsius
    SMILES: NCCC1=CC=C(C=C1)S(=O)(=O)NC
  10. N-(6-cyclopropyl-7-((3,5-dichlorophenoxy)methyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanesulfonamide

    CAS No.: 1629064-32-9
    Catalog No.: TQR0652
    Purity: 95%
    MF: C17H16Cl2N4O3S
    MW: 427.313
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1C(=CC=2N(C1)C(=NN2)NS(=O)(=O)C)COC2=CC(=CC(=C2)Cl)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 460 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5