•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinoxalines

Set Ascending Direction

   

Items 1 to 10 of 73 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-fluoro-7-nitroquinoxaline-2,3(1H,4H)-dione

    CAS No.: 143151-09-1
    Catalog No.: 177268
    Purity: 95%
    MF: C8H4FN3O4
    MW: 225.135
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(NC(=O)C(=O)N2)C=C1F
  2. methyl 2-(3-oxo-1,2,3,4-tetrahydroquinoxalin-2-yl)acetate

    CAS No.: 491850-48-7
    Catalog No.: 191391
    Purity: 95%
    MF: C11H12N2O3
    MW: 220.228
    Storage: 2-8 degree Celsius
    SMILES: O=C1C(NC2=CC=CC=C2N1)CC(=O)OC
  3. 8-chloroquinoxalin-2-ol

    CAS No.: 65180-12-3
    Catalog No.: 184215
    Purity: 95%
    MF: C8H5ClN2O
    MW: 180.594
    Storage: 2-8 degree Celsius
    SMILES: OC1=NC2=C(Cl)C=CC=C2N=C1
  4. 2,5-dichloroquinoxaline

    CAS No.: 55687-05-3
    Catalog No.: 184008
    Purity: 95%
    MF: C8H4Cl2N2
    MW: 199.04
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC=CC(Cl)=C2N=C1
  5. N-(tert-butyl)-3,6,7-trichloroquinoxalin-2-amine

    CAS No.: 281211-09-4
    Catalog No.: 177338
    Purity: 95%
    MF: C12H12Cl3N3
    MW: 304.608
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)NC1=NC2=CC(Cl)=C(Cl)C=C2N=C1Cl
  6. 2,8-dichloroquinoxaline

    CAS No.: 120258-69-7
    Catalog No.: 138931
    Purity: 95%
    MF: C8H4Cl2N2
    MW: 199.04
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=C(Cl)C=CC=C2N=C1
  7. 3-chloroquinoxaline-6-carbaldehyde

    CAS No.: 1427632-20-9
    Catalog No.: 191477
    Purity: 95%
    MF: C9H5ClN2O
    MW: 192.605
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=NC2=CC=C(C=C2N1)C=O
  8. 6-bromo-2-chloro-3-methylquinoxaline

    CAS No.: 98416-72-9
    Catalog No.: 186826
    Purity: 95%
    MF: C9H6BrClN2
    MW: 257.518
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2N=C(C(=NC2=CC1)Cl)C
  9. Chlorsulfaquinoxalin?e

    CAS No.: 97919-22-7
    Catalog No.: 185278
    Purity: 95%
    MF: C14H11ClN4O2S
    MW: 334.788
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=C1)S(=O)(=O)NC1=NC2=CC=CC(=C2N=C1)Cl
  10. 4a,5,6,7,8,8a-hexahydroquinoxalin-2(1H)-one

    CAS No.: 1824351-03-2
    Catalog No.: 181672
    Purity: 95%
    MF: C8H12N2O
    MW: 152.197
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC2CCCCC2N=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 73 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5