•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrimidines

Set Descending Direction

   

Items 61 to 70 of 109 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. ethyl 2-chloro-5H-pyrrolo[3,2-d]pyrimidine-4-carboxylate

    CAS No.: 1256352-79-0
    Catalog No.: TQP2686
    Purity: 95%
    MF: C9H8ClN3O2
    MW: 225.635
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=C(C2=C(N1)C=CN2)C(=O)OCC
  2. 2,4-dichloro-7-(2-fluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 1220517-99-6
    Catalog No.: 100376
    Purity: 95%
    MF: C8H6Cl2FN3
    MW: 234.061
    Storage: 2-8 degree Celsius
    SMILES: FCCN1C=CC2=C(Cl)N=C(Cl)N=C12
  3. 2,4-dichloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 90213-67-5
    Catalog No.: 100377
    Purity: 95%
    MF: C7H5Cl2N3
    MW: 202.044
    Storage: 2-8 degree Celsius
    SMILES: CN1C=CC2=C(Cl)N=C(Cl)N=C12
  4. 2,4-dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 1220518-04-6
    Catalog No.: 100378
    Purity: 95%
    MF: C9H7Cl2N3
    MW: 228.082
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(Cl)=C2C=CN(C3CC3)C2=N1
  5. 4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 35808-68-5
    Catalog No.: 101249
    Purity: 95%
    MF: C7H6ClN3
    MW: 167.599
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(Cl)N=CN=C2N1
  6. 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid

    CAS No.: 186519-92-6
    Catalog No.: 102451
    Purity: 95%
    MF: C7H4ClN3O2
    MW: 197.581
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CNC2=NC=NC(Cl)=C12
  7. 2,4,5-trichloro-7H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 1053228-28-6
    Catalog No.: 102773
    Purity: 95%
    MF: C6H2Cl3N3
    MW: 222.462
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CNC2=NC(Cl)=NC(Cl)=C12
  8. 4-chloro-2-methyl-1H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 71149-52-5
    Catalog No.: 102871
    Purity: 95%
    MF: C7H6ClN3
    MW: 167.599
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC(Cl)=C2C=CN=C2N1
  9. ethyl 2-amino-4-chloro-5H-pyrrolo[3,4-d]pyrimidine-6(7H)-carboxylate

    CAS No.: 1046861-17-9
    Catalog No.: 103196
    Purity: 95%
    MF: C9H11ClN4O2
    MW: 242.666
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)N1CC2=NC(N)=NC(Cl)=C2C1
  10. 4-amino-7H-pyrrolo[2,3-d]pyrimidine

    CAS No.: 1500-85-2
    Catalog No.: 112749
    Purity: 95%
    MF: C6H6N4
    MW: 134.142
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C=CNC2=NC=N1
Loading ...Load More ...
Set Descending Direction

   

Items 61 to 70 of 109 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9