•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyridines

Set Ascending Direction

   

Items 11 to 20 of 354 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4,6-dichloro-1-methyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 114244-83-6
    Catalog No.: TQP0465
    Purity: 95%
    MF: C8H6Cl2N2
    MW: 201.056
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC2=C1C=CN2C)Cl
  2. tert-butyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-1-carboxylate

    CAS No.: 1609259-26-8
    Catalog No.: TQP0466
    Purity: 95%
    MF: C12H13ClN2O2
    MW: 252.701
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2C(=O)OC(C)(C)C
  3. 1-chloro-6H-pyrido[3,4-b]pyrrolizin-8(7H)-one

    CAS No.: 688357-21-3
    Catalog No.: TQP0467
    Purity: 95%
    MF: C10H7ClN2O
    MW: 206.632
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=C1C(CCN21)=O
  4. (4-chloro-1-methyl-1H-pyrrolo[3,2-c]pyridin-7-yl)(piperidin-1-yl)methanone

    CAS No.: 871819-62-4
    Catalog No.: TQP0468
    Purity: 95%
    MF: C14H16ClN3O
    MW: 277.755
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C2=C1C=CN2C)C(=O)N2CCCCC2
  5. 1-benzyl-6-chloro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile

    CAS No.: 70357-64-1
    Catalog No.: TQP0469
    Purity: 95%
    MF: C15H10ClN3
    MW: 267.719
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C=CC=2C=NC(=C(C21)C#N)Cl
  6. 6-chloro-1-cyclopropyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1324003-17-9
    Catalog No.: TQP0470
    Purity: 95%
    MF: C10H9ClN2
    MW: 192.649
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)C=CN2C2CC2
  7. 6-chloro-1-methyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1935104-56-5
    Catalog No.: TQP0471
    Purity: 95%
    MF: C8H7ClN2
    MW: 166.611
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)C=CN2C
  8. tert-butyl 6-chloro-1H-pyrrolo[3,2-c]pyridine-1-carboxylate

    CAS No.: 1649468-62-1
    Catalog No.: TQP0472
    Purity: 95%
    MF: C12H13ClN2O2
    MW: 252.701
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)C=CN2C(=O)OC(C)(C)C
  9. 6-chloro-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1403899-38-6
    Catalog No.: TQP0473
    Purity: 95%
    MF: C13H19ClN2OSi
    MW: 282.847
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)C=CN2COCC[Si](C)(C)C
  10. 6-chloro-1-phenyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1612172-08-3
    Catalog No.: TQP0474
    Purity: 95%
    MF: C13H9ClN2
    MW: 228.682
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(C=N1)C=CN2C2=CC=CC=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 354 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5