•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyridines

Set Ascending Direction

   

Items 1 to 10 of 354 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1,1-dimethylethyl (4aS,7aS)-octahydro-1H-pyrrolo[3,4-b]pyridine-1-carboxylate

    CAS No.: 159991-07-8
    Catalog No.: 193059
    Purity: 95%
    MF: C12H22N2O2
    MW: 226.32
    Storage: 2-8 degree Celsius
    SMILES: N1([C@H]2[C@@H](CCC1)CNC2)C(=O)OC(C)(C)C
  2. 2-benzyl-2H-pyrrolo[3,4-c]pyridine-1,3-dione

    CAS No.: 18205-25-9
    Catalog No.: 193060
    Purity: 95%
    MF: C14H10N2O2
    MW: 238.246
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C(C=2C=NC=CC2C1=O)=O
  3. 4-chloro-1-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 170430-88-3
    Catalog No.: TQP0457
    Purity: 95%
    MF: C13H6Cl2F3N3
    MW: 332.112
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2C2=NC=C(C=C2Cl)C(F)(F)F
  4. 4-chloro-1-(2-chloro-4-(trifluoromethyl)phenyl)-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 170430-83-8
    Catalog No.: TQP0458
    Purity: 95%
    MF: C14H7Cl2F3N2
    MW: 331.124
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2C2=C(C=C(C=C2)C(F)(F)F)Cl
  5. 4-chloro-1-methyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 27382-01-0
    Catalog No.: TQP0459
    Purity: 95%
    MF: C8H7ClN2
    MW: 166.611
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2C
  6. 1-benzyl-4-chloro-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 35636-10-3
    Catalog No.: TQP0460
    Purity: 95%
    MF: C14H11ClN2
    MW: 242.709
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C=CC=2C(=NC=CC21)Cl
  7. 4-chloro-1-(4-fluorobenzyl)-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1160359-96-5
    Catalog No.: TQP0461
    Purity: 95%
    MF: C14H10ClFN2
    MW: 260.699
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2CC2=CC=C(C=C2)F
  8. 4-chloro-1-(4-methoxybenzyl)-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1313714-53-2
    Catalog No.: TQP0462
    Purity: 95%
    MF: C15H13ClN2O
    MW: 272.735
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2CC2=CC=C(C=C2)OC
  9. tert-butyl 4-(2-(4-chloro-1H-pyrrolo[3,2-c]pyridin-1-yl)acetyl)piperazine-1-carboxylate

    CAS No.: 494767-46-3
    Catalog No.: TQP0463
    Purity: 95%
    MF: C18H23ClN4O3
    MW: 378.86
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2CC(=O)N2CCN(CC2)C(=O)OC(C)(C)C
  10. 4-chloro-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1609259-25-7
    Catalog No.: TQP0464
    Purity: 95%
    MF: C13H19ClN2OSi
    MW: 282.847
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C=CN2COCC[Si](C)(C)C
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 354 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5