•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolidines

Set Descending Direction

   

Items 1 to 10 of 827 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (3S,4R)-4-phenylpyrrolidine-3-carboxylic acid hydrochloride

    CAS No.: 1049755-65-8
    Catalog No.: 192978
    Purity: 95%
    MF: C11H14ClNO2
    MW: 227.691
    Storage: 2-8 degree Celsius
    SMILES: Cl.C1(=CC=CC=C1)[C@H]1[C@@H](CNC1)C(=O)O
  2. (S)-N-methyl(pyrrolidin-2-yl)methanamine

    CAS No.: 110638-61-4
    Catalog No.: 192979
    Purity: 95%
    MF: C6H14N2
    MW: 114.192
    Storage: 2-8 degree Celsius
    SMILES: CNC[C@H]1NCCC1
  3. (trans)-2,5-dimethylpyrrolidine hydrochloride

    CAS No.: 114143-75-8
    Catalog No.: 192980
    Purity: 95%
    MF: C6H14ClN
    MW: 135.638
    Storage: 2-8 degree Celsius
    SMILES: Cl.C[C@@H]1N[C@H](CC1)C
  4. 4-(2-bromophenyl)pyrrolidin-2-one

    CAS No.: 1171825-24-3
    Catalog No.: 192982
    Purity: 95%
    MF: C10H10BrNO
    MW: 240.1
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC=C1)C1CC(NC1)=O
  5. 3-aminopyrrolidin-2-one hydrochloride

    CAS No.: 117879-49-9
    Catalog No.: 192983
    Purity: 95%
    MF: C4H9ClN2O
    MW: 136.582
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1C(NCC1)=O
  6. (S)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride

    CAS No.: 1190890-11-9
    Catalog No.: 192984
    Purity: 95%
    MF: C10H21ClN2O2
    MW: 236.743
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC[C@H]1N(CCC1)C(=O)OC(C)(C)C
  7. (R)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride

    CAS No.: 1190890-12-0
    Catalog No.: 192985
    Purity: 95%
    MF: C10H21ClN2O2
    MW: 236.743
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC[C@@H]1N(CCC1)C(=O)OC(C)(C)C
  8. tert-butyl 3-(2-bromophenyl)pyrrolidine-1-carboxylate

    CAS No.: 1203685-04-4
    Catalog No.: 192987
    Purity: 95%
    MF: C15H20BrNO2
    MW: 326.234
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=CC=C1)C1CN(CC1)C(=O)OC(C)(C)C
  9. ethyl 1-benzyl-4-hydroxy-5-oxopyrrolidine-3-carboxylate

    CAS No.: 1208081-95-1
    Catalog No.: 192988
    Purity: 95%
    MF: C14H17NO4
    MW: 263.293
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1CC(C(C1=O)O)C(=O)OCC
  10. tert-Butyl (trans-4-(4-(trifluoromethyl)phenyl)pyrrolidin-3-yl)carbamate

    CAS No.: 1212404-61-9
    Catalog No.: 192989
    Purity: 95%
    MF: C16H21F3N2O2
    MW: 330.35
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=CC=C(C=C1)[C@H]1[C@@H](CNC1)NC(OC(C)(C)C)=O)(F)F
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 827 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5