•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrroles

Set Descending Direction

   

Items 61 to 70 of 141 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 2-(4-(1H-Pyrrol-1-yl)phenoxy)acetic acid

    CAS No.: 404892-58-6
    Catalog No.: 198244
    Purity: 95%
    MF: C12H11NO3
    MW: 217.224
    Storage: 2-8 degree Celsius
    SMILES: N1(C=CC=C1)C1=CC=C(OCC(=O)O)C=C1
  2. ethyl 4-phenyl-1H-pyrrole-2-carboxylate

    CAS No.: 127572-58-1
    Catalog No.: 198246
    Purity: 95%
    MF: C13H13NO2
    MW: 215.252
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C=1C=C(NC1)C(=O)OCC
  3. 5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole

    CAS No.: 1443623-92-4
    Catalog No.: 198247
    Purity: 95%
    MF: C10H9F2N
    MW: 181.185
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=C(C=C1)F)C=1CCCN1
  4. 4-phenyl-1H-pyrrole-2-carboxylic acid

    CAS No.: 79600-87-6
    Catalog No.: 198249
    Purity: 95%
    MF: C11H9NO2
    MW: 187.198
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C=1C=C(NC1)C(=O)O
  5. 5-bromo-2-(2,5-dimethyl-1H-pyrrol-1-yl)pyrimidine

    CAS No.: 478258-81-0
    Catalog No.: TQP0236
    Purity: 95%
    MF: C10H10BrN3
    MW: 252.115
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NC(=NC1)N1C(=CC=C1C)C
  6. 3-(1H-pyrrol-1-yl)pyridin-2-amine

    CAS No.: 104149-41-9
    Catalog No.: TQP1475
    Purity: 95%
    MF: C9H9N3
    MW: 159.192
    Storage: 2-8 degree Celsius
    SMILES: N1(C=CC=C1)C=1C(=NC=CC1)N
  7. N-(2-(2-(2-(3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamido)ethoxy)ethoxy)ethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide

    CAS No.: 305372-39-8
    Catalog No.: TQP2459
    Purity: 95%
    MF: C23H35N5O7S
    MW: 525.628
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C(C=C1)=O)CCC(=O)NCCOCCOCCNC(CCCC[C@@H]1SC[C@@H]2NC(N[C@@H]21)=O)=O
  8. 2-fluoro-6-(1H-pyrrol-1-yl)benzonitrile

    CAS No.: 148901-51-3
    Catalog No.: TQP2704
    Purity: 95%
    MF: C11H7FN2
    MW: 186.189
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C#N)C(=CC=C1)N1C=CC=C1
  9. isopropyl 4-(2-amino-3-cyano-1H-pyrrol-1-yl)piperidine-1-carboxylate

    CAS No.: 1236284-61-9
    Catalog No.: TQP2719
    Purity: 95%
    MF: C14H20N4O2
    MW: 276.34
    Storage: 2-8 degree Celsius
    SMILES: NC=1N(C=CC1C#N)C1CCN(CC1)C(=O)OC(C)C
  10. 2-amino-1-ethyl-1H-pyrrole-3-carbonitrile

    CAS No.: 412341-22-1
    Catalog No.: TQP2720
    Purity: 95%
    MF: C7H9N3
    MW: 135.17
    Storage: 2-8 degree Celsius
    SMILES: NC=1N(C=CC1C#N)CC
Loading ...Load More ...
Set Descending Direction

   

Items 61 to 70 of 141 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9