•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrimidines

Set Ascending Direction

   

Items 41 to 50 of 1117 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 2,4-diethoxy-5-methylpyrimidine

    CAS No.: 7193-87-5
    Catalog No.: TQR0187
    Purity: 95%
    MF: C9H14N2O2
    MW: 182.223
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC1=NC=C(C(=N1)OCC)C
  2. 1-benzyl-4-ethoxy-5-methylpyrimidin-2(1H)-one

    CAS No.: 2304883-26-7
    Catalog No.: TQR0188
    Purity: 95%
    MF: C14H16N2O2
    MW: 244.294
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C(N=C(C(=C1)C)OCC)=O
  3. 4-ethoxy-1,5-dimethylpyrimidin-2(1H)-one

    CAS No.: 6220-45-7
    Catalog No.: TQR0189
    Purity: 95%
    MF: C8H12N2O2
    MW: 168.196
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC1=NC(N(C=C1C)C)=O
  4. 4-chloro-6-((methylsulfonyl)methyl)-2-(methylthio)pyrimidine

    CAS No.: 1009635-18-0
    Catalog No.: TQR0245
    Purity: 95%
    MF: C7H9ClN2O2S2
    MW: 252.748
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=NC(=C1)CS(=O)(=O)C)SC
  5. 6-(chloromethyl)-2-(methylthio)pyrimidin-4-ol

    CAS No.: 89639-37-2
    Catalog No.: TQR0246
    Purity: 95%
    MF: C6H7ClN2OS
    MW: 190.655
    Storage: 2-8 degree Celsius
    SMILES: ClCC1=CC(=NC(=N1)SC)O
  6. 4-chloro-6-(1-(methylsulfonyl)cyclopropyl)-2-(methylthio)pyrimidine

    CAS No.: 2361394-59-2
    Catalog No.: TQR0247
    Purity: 95%
    MF: C9H11ClN2O2S2
    MW: 278.786
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=NC(=C1)C1(CC1)S(=O)(=O)C)SC
  7. (R)-4-(2-chloro-6-(iodomethyl)pyrimidin-4-yl)-3-methylmorpholine

    CAS No.: 1233339-72-4
    Catalog No.: TQR0249
    Purity: 95%
    MF: C10H13ClIN3O
    MW: 353.591
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC(=N1)N1[C@@H](COCC1)C)CI
  8. (S)-4-(2-chloro-6-(iodomethyl)pyrimidin-4-yl)-3-methylmorpholine

    CAS No.: 1009628-22-1
    Catalog No.: TQR0250
    Purity: 95%
    MF: C10H13ClIN3O
    MW: 353.591
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC(=N1)N1[C@H](COCC1)C)CI
  9. (R)-4-(2-chloro-6-((methylthio)methyl)pyrimidin-4-yl)-3-methylmorpholine

    CAS No.: 1352227-15-6
    Catalog No.: TQR0251
    Purity: 95%
    MF: C11H16ClN3OS
    MW: 273.789
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC(=N1)N1[C@@H](COCC1)C)CSC
  10. methyl 2-ethyl-5-hydroxy-6-oxo-1,6-dihydropyrimidine-4-carboxylate

    CAS No.: 1408237-10-4
    Catalog No.: TQR0253
    Purity: 95%
    MF: C8H10N2O4
    MW: 198.178
    Storage: 2-8 degree Celsius
    SMILES: C(C)C=1NC(C(=C(N1)C(=O)OC)O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 1117 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7