•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrimidines

Set Descending Direction

   

Items 21 to 30 of 1117 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-cyclopropylpyrimidine-2-carbonitrile

    CAS No.: 1269429-26-6
    Catalog No.: TQ0061
    Purity: 95%
    MF: C8H7N3
    MW: 145.165
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=NC(=NC=C1)C#N
  2. methyl 4-cyclopropylpyrimidine-2-carboxylate

    CAS No.: 1378520-74-1
    Catalog No.: TQ0063
    Purity: 95%
    MF: C9H10N2O2
    MW: 178.191
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=NC(=NC=C1)C(=O)OC
  3. 5-cyclopropylpyrimidine-2-carbonitrile

    CAS No.: 1932615-71-8
    Catalog No.: TQ0065
    Purity: 95%
    MF: C8H7N3
    MW: 145.165
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1C=NC(=NC1)C#N
  4. (5-cyclopropylpyrimidin-2-yl)methanamine hydrochloride

    CAS No.: 1785247-04-2
    Catalog No.: TQ0066
    Purity: 95%
    MF: C8H12ClN3
    MW: 185.658
    Storage: 2-8 degree Celsius
    SMILES: Cl.C1(CC1)C=1C=NC(=NC1)CN
  5. methyl 5-cyclopropylpyrimidine-2-carboxylate

    CAS No.: 1459748-97-0
    Catalog No.: TQ0067
    Purity: 95%
    MF: C9H10N2O2
    MW: 178.191
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C=1C=NC(=NC1)C(=O)OC
  6. 5-isopropylpyrimidine-2-carboxylic acid

    CAS No.: 1550759-74-4
    Catalog No.: TQ0068
    Purity: 95%
    MF: C8H10N2O2
    MW: 166.18
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1C=NC(=NC1)C(=O)O
  7. 4-cyclopropylpyrimidine-5-carboxylic acid

    CAS No.: 954232-79-2
    Catalog No.: TQ0069
    Purity: 95%
    MF: C8H8N2O2
    MW: 164.164
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=NC=NC=C1C(=O)O
  8. methyl 4-isopropylpyrimidine-5-carboxylate

    CAS No.: 1448777-02-3
    Catalog No.: TQ0070
    Purity: 95%
    MF: C9H12N2O2
    MW: 180.207
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C1=NC=NC=C1C(=O)OC
  9. methyl pyrazolo[1,5-a]pyrimidine-3-carboxylate

    CAS No.: 384861-43-2
    Catalog No.: TQ0100
    Purity: 95%
    MF: C8H7N3O2
    MW: 177.163
    Storage: 2-8 degree Celsius
    SMILES: N1=CC(=C2N1C=CC=N2)C(=O)OC
  10. 4-(difluoromethyl)pyrimidin-2-amine

    CAS No.: 1780891-13-5
    Catalog No.: TQ0102
    Purity: 95%
    MF: C5H5F2N3
    MW: 145.112
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC(=NC=C1)N)F
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 1117 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5