•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridoxazines

Set Descending Direction

   

Items 1 to 10 of 24 total

  1. 1
  2. 2
  3. 3
  1. 3-ethyl-7-(hydroxymethyl)-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one

    CAS No.: 2851897-82-8
    Catalog No.: 197676
    Purity: 95%
    MF: C10H12N2O3
    MW: 208.217
    Storage: 2-8 degree Celsius
    SMILES: C(C)C1C(NC2=C(O1)N=CC(=C2)CO)=O
  2. 2-phenyl-4H-pyrido[2,3-d][1,3]oxazin-4-one

    CAS No.: 23411-09-8
    Catalog No.: CP0067
    Purity: 95%
    MF: C13H8N2O2
    MW: 224.219
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C=1OC(C2=C(N1)N=CC=C2)=O
  3. 7-chloro-2H-pyrido[4,3-b][1,4]oxazin-3(4H)-one

    CAS No.: 1206977-63-0
    Catalog No.: 184911
    Purity: 95%
    MF: C7H5ClN2O2
    MW: 184.582
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC(=O)CO2)C=N1
  4. 8-bromo-6-methyl-4,6-dihydro-2H-pyrido[4,3-b][1,4]oxazine-3,5-dione

    CAS No.: 1706753-22-1
    Catalog No.: 184252
    Purity: 95%
    MF: C8H7BrN2O3
    MW: 259.059
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(Br)C2=C(NC(=O)CO2)C1=O
  5. 6-iodo-1-methyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione

    CAS No.: 1034131-28-6
    Catalog No.: 140860
    Purity: 95%
    MF: C8H5IN2O3
    MW: 304.043
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)OC(=O)C2=CC(I)=CN=C12
  6. 7-chloro-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine

    CAS No.: 1221278-53-0
    Catalog No.: TQP0552
    Purity: 95%
    MF: C7H7ClN2O
    MW: 170.599
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=2OCCNC2C=N1
  7. 7-chloro-4-methyl-2H-pyrido[4,3-b][1,4]oxazin-3(4H)-one

    CAS No.: 1802660-38-3
    Catalog No.: TQP0529
    Purity: 95%
    MF: C8H7ClN2O2
    MW: 198.609
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=2OCC(N(C2C=N1)C)=O
  8. 6-methyl-4,6-dihydro-2H-pyrido[4,3-b][1,4]oxazine-3,5-dione

    CAS No.: 1706753-19-6
    Catalog No.: 184251
    Purity: 95%
    MF: C8H8N2O3
    MW: 180.163
    Storage: 2-8 degree Celsius
    SMILES: CN1C=CC2=C(NC(=O)CO2)C1=O
  9. 7-Bromo-2,3-dihydro-8-methyl-1H-pyrido[2,3-b][1,4]oxazine

    CAS No.: 2169906-55-0
    Catalog No.: 194445
    Purity: 95%
    MF: C8H9BrN2O
    MW: 229.077
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C2=C(OCCN2)N=C1)C
  10. 7-bromo-1H-pyrido[3,4-b][1,4]oxazin-2(3H)-one

    CAS No.: 943995-72-0
    Catalog No.: 185427
    Purity: 95%
    MF: C7H5BrN2O2
    MW: 229.033
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(OCC(N2)=O)C=N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 24 total

  1. 1
  2. 2
  3. 3