•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridoindoles

Set Ascending Direction

   

Items 21 to 30 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 9-tosyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole 2,2,2-trifluoroacetic acid

    CAS No.: NA
    Catalog No.: 193401
    Purity: 95%
    MF: C20H19F3N2O4S
    MW: 440.443
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(C(O)=O)F.O=S(N1C(CNCC2)=C2C3=C1C=CC=C3)(C4=CC=C(C)C=C4)=O
  2. 6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 23046-68-6
    Catalog No.: TQ0164
    Purity: 95%
    MF: C11H11ClN2
    MW: 206.676
    Storage: -20 degree Celsius
    SMILES: ClC=1C=C2C3=C(NC2=CC1)CNCC3
  3. 7-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 91566-22-2
    Catalog No.: TQ0174
    Purity: 95%
    MF: C12H14N2O
    MW: 202.257
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C3=C(NC2=C1)CNCC3
  4. tert-butyl 6-chloro-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1172588-21-4
    Catalog No.: TQ0163
    Purity: 95%
    MF: C16H19ClN2O2
    MW: 306.793
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2C3=C(NC2=CC1)CN(CC3)C(=O)OC(C)(C)C
  5. tert-butyl 6-fluoro-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1579291-64-7
    Catalog No.: TQ0165
    Purity: 95%
    MF: C16H19FN2O2
    MW: 290.338
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C2C3=C(NC2=CC1)CN(CC3)C(=O)OC(C)(C)C
  6. 6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 17952-80-6
    Catalog No.: TQ0166
    Purity: 95%
    MF: C11H11FN2
    MW: 190.221
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C2C3=C(NC2=CC1)CNCC3
  7. tert-butyl 6-bromo-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1173155-59-3
    Catalog No.: TQ0167
    Purity: 95%
    MF: C16H19BrN2O2
    MW: 351.244
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C3=C(NC2=CC1)CN(CC3)C(=O)OC(C)(C)C
  8. 6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 23046-69-7
    Catalog No.: TQ0168
    Purity: 95%
    MF: C11H11BrN2
    MW: 251.127
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C3=C(NC2=CC1)CNCC3
  9. 6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 3464-80-0
    Catalog No.: TQ0169
    Purity: 95%
    MF: C12H14N2
    MW: 186.258
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C2C3=C(NC2=CC1)CNCC3
  10. tert-butyl 6-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1579291-63-6
    Catalog No.: TQ0170
    Purity: 95%
    MF: C17H22N2O2
    MW: 286.375
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C2C3=C(NC2=CC1)CN(CC3)C(=O)OC(C)(C)C
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5