•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridines

Set Ascending Direction

   

Items 41 to 50 of 4138 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 4-bromo-5-methylpicolinonitrile

    CAS No.: 1353856-72-0
    Catalog No.: 192956
    Purity: 95%
    MF: C7H5BrN2
    MW: 197.035
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=NC=C1C)C#N
  2. ethyl 4,6-dimethylnicotinate

    CAS No.: 46174-51-0
    Catalog No.: 192957
    Purity: 95%
    MF: C10H13NO2
    MW: 179.219
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(=NC=C1C(=O)OCC)C
  3. 4-fluoro-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridin-2-ylamine

    CAS No.: 944401-71-2
    Catalog No.: 192958
    Purity: 95%
    MF: C11H16BFN2O2
    MW: 238.071
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC(=NC=C1B1OC(C(O1)(C)C)(C)C)N
  4. N1,N1-bis(pyridin-2-ylmethyl)ethane-1,2-diamine

    CAS No.: 189440-33-3
    Catalog No.: 193727
    Purity: 95%
    MF: C14H18N4
    MW: 242.326
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=CC=C1)CN(CCN)CC1=NC=CC=C1
  5. 2-(trifluoromethyl)pyridine

    CAS No.: 368-48-9
    Catalog No.: 193844
    Purity: 95%
    MF: C6H4F3N
    MW: 147.099
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC=CC=C1)(F)F
  6. 6-bromo-5-(trifluoromethyl)pyridin-3-amine

    CAS No.: 1642844-33-4
    Catalog No.: 194171
    Purity: 95%
    MF: C6H4BrF3N2
    MW: 241.01
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C=N1)N)C(F)(F)F
  7. 1-(pyridin-4-yl)piperidin-4-amine dihydrochloride

    CAS No.: 1169396-92-2
    Catalog No.: 194217
    Purity: 95%
    MF: C10H17Cl2N3
    MW: 250.173
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1=CC=C(C=C1)N1CCC(CC1)N
  8. 4-chloro-2-(chloromethyl)-3-methylpyridine hydrochloride

    CAS No.: 152402-97-6
    Catalog No.: 194218
    Purity: 95%
    MF: C7H8Cl3N
    MW: 212.507
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC1=C(C(=NC=C1)CCl)C
  9. 2-chloro-6-(trifluoromethyl)pyridine

    CAS No.: 39890-95-4
    Catalog No.: 194240
    Purity: 95%
    MF: C6H3ClF3N
    MW: 181.544
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC=C1)C(F)(F)F
  10. pyridine-2-sulfonyl fluoride

    CAS No.: 878376-35-3
    Catalog No.: 194266
    Purity: 95%
    MF: C5H4FNO2S
    MW: 161.157
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=CC=C1)S(=O)(=O)F
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 4138 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7