•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridines

Set Ascending Direction

   

Items 21 to 30 of 4138 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-tert-butylpyridin-3-amine hydrochloride

    CAS No.: 2135331-65-4
    Catalog No.: 192936
    Purity: 95%
    MF: C9H15ClN2
    MW: 186.686
    Storage: 2-8 degree Celsius
    SMILES: Cl.C(C)(C)(C)C=1C=C(C=NC1)N
  2. methyl 5-tert-butylpicolinate

    CAS No.: 215436-29-6
    Catalog No.: 192937
    Purity: 95%
    MF: C11H15NO2
    MW: 193.246
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C=1C=CC(=NC1)C(=O)OC
  3. N,N,4-trimethyl-5-nitropyridin-2-amine

    CAS No.: 21901-43-9
    Catalog No.: 192938
    Purity: 95%
    MF: C8H11N3O2
    MW: 181.195
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=NC=C(C(=C1)C)[N+](=O)[O-])C
  4. 4,6-dimethylnicotinic acid

    CAS No.: 22047-86-5
    Catalog No.: 192939
    Purity: 95%
    MF: C8H9NO2
    MW: 151.165
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(=NC=C1C(=O)O)C
  5. tert-butyl 2-carbamoylpyridin-3-ylcarbamate

    CAS No.: 2288709-59-9
    Catalog No.: 192940
    Purity: 95%
    MF: C11H15N3O3
    MW: 237.259
    Storage: 2-8 degree Celsius
    SMILES: C(N)(=O)C1=NC=CC=C1NC(OC(C)(C)C)=O
  6. 2-(3-fluoropyridin-4-yl)propan-2-amine dihydrochloride

    CAS No.: 2442597-47-7
    Catalog No.: 192941
    Purity: 95%
    MF: C8H13Cl2FN2
    MW: 227.11
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.FC=1C=NC=CC1C(C)(C)N
  7. 6-amino-4-fluoropyridin-3-ol hydrochloride

    CAS No.: 2703752-58-1
    Catalog No.: 192942
    Purity: 95%
    MF: C5H6ClFN2O
    MW: 164.567
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1=CC(=C(C=N1)O)F
  8. 2-chloro-5-(2-ethoxy-2-oxoethoxy)pyridine 1-oxide

    CAS No.: 2703756-63-0
    Catalog No.: 192943
    Purity: 95%
    MF: C9H10ClNO4
    MW: 231.635
    Storage: 2-8 degree Celsius
    SMILES: ClC1=[N+](C=C(C=C1)OCC(=O)OCC)[O-]
  9. thiazolo[4,5-b]pyridine

    CAS No.: 273-98-3
    Catalog No.: 192944
    Purity: 95%
    MF: C6H4N2S
    MW: 136.179
    Storage: 2-8 degree Celsius
    SMILES: S1C=NC2=NC=CC=C21
  10. (S)-1-(pyridin-3-yl)ethanamine dihydrochloride

    CAS No.: 40154-84-5
    Catalog No.: 192945
    Purity: 95%
    MF: C7H12Cl2N2
    MW: 195.093
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1=CC(=CC=C1)[C@H](C)N
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 4138 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5