•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridazines

Set Ascending Direction

   

Items 31 to 40 of 264 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 4-(piperidin-4-yl)pyridazin-3(2H)-one

    CAS No.: 862280-61-3
    Catalog No.: TQP0525
    Purity: 95%
    MF: C9H13N3O
    MW: 179.223
    Storage: 2-8 degree Celsius
    SMILES: N1CCC(CC1)C=1C(NN=CC1)=O
  2. benzyl 4-(3-oxo-2,3-dihydropyridazin-4-yl)piperidine-1-carboxylate

    CAS No.: 862280-64-6
    Catalog No.: TQP0527
    Purity: 95%
    MF: C17H19N3O3
    MW: 313.357
    Storage: 2-8 degree Celsius
    SMILES: O=C1NN=CC=C1C1CCN(CC1)C(=O)OCC1=CC=CC=C1
  3. 6-chloro-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyridazin-3-amine

    CAS No.: 1562338-65-1
    Catalog No.: TQR0171
    Purity: 95%
    MF: C14H23ClN4
    MW: 282.819
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(N=N1)N(C1CC(NC(C1)(C)C)(C)C)C
  4. 6-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyridazin-3-amine

    CAS No.: 1211459-79-8
    Catalog No.: TQR0172
    Purity: 95%
    MF: C13H21ClN4
    MW: 268.792
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(N=N1)NC1CC(NC(C1)(C)C)(C)C
  5. 3-(2-chloropyrimidin-4-yl)pyrazolo[1,5-b]pyridazine

    CAS No.: 2244975-98-0
    Catalog No.: TQR1451
    Purity: 95%
    MF: C10H6ClN5
    MW: 231.646
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC(=N1)C=1C=NN2N=CC=CC21
  6. 3-(2-chloropyrimidin-4-yl)-6-methoxypyrazolo[1,5-b]pyridazine

    CAS No.: 2413254-19-8
    Catalog No.: TQR1452
    Purity: 95%
    MF: C11H8ClN5O
    MW: 261.672
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC(=N1)C=1C=NN2N=C(C=CC21)OC
  7. pyrazolo[1,5-b]pyridazine-3-carboxylic acid

    CAS No.: 88561-91-5
    Catalog No.: TQR1453
    Purity: 95%
    MF: C7H5N3O2
    MW: 163.136
    Storage: 2-8 degree Celsius
    SMILES: N1=CC(=C2N1N=CC=C2)C(=O)O
  8. 3-bromopyrazolo[1,5-b]pyridazine

    CAS No.: 1137949-68-8
    Catalog No.: TQR1454
    Purity: 95%
    MF: C6H4BrN3
    MW: 198.023
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NN2N=CC=CC21
  9. 4-bromo-6-chloro-2-methylpyridazin-3(2H)-one

    CAS No.: 1178884-53-1
    Catalog No.: TQR1532
    Purity: 95%
    MF: C5H4BrClN2O
    MW: 223.457
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(N(N=C(C1)Cl)C)=O
  10. 3,6-dichloro-4-methylpyridazine

    CAS No.: 19064-64-3
    Catalog No.: 103230
    Purity: 95%
    MF: C5H4Cl2N2
    MW: 163.007
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(Cl)=NN=C1Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 264 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6