•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazoles

Set Ascending Direction

   

Items 41 to 50 of 842 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 5-(1H-indol-6-yl)-1H-pyrazol-3-amine

    CAS No.: 2377407-37-7
    Catalog No.: TQR0086
    Purity: 95%
    MF: C11H10N4
    MW: 198.229
    Storage: 2-8 degree Celsius
    SMILES: N1C=CC2=CC=C(C=C12)C1=CC(=NN1)N
  2. 3-amino-5-(1H-indol-6-yl)-1H-pyrazole-4-carbonitrile

    CAS No.: 2374732-92-8
    Catalog No.: TQR0087
    Purity: 95%
    MF: C12H9N5
    MW: 223.239
    Storage: 2-8 degree Celsius
    SMILES: NC1=NNC(=C1C#N)C1=CC=C2C=CNC2=C1
  3. 1-(4-bromo-3-methoxyphenyl)-1H-pyrazole

    CAS No.: 1378878-50-2
    Catalog No.: TQR0167
    Purity: 95%
    MF: C10H9BrN2O
    MW: 253.099
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(C=C1)N1N=CC=C1)OC
  4. 1-(3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole

    CAS No.: 1562338-80-0
    Catalog No.: TQR0168
    Purity: 95%
    MF: C16H21BN2O3
    MW: 300.167
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C(C=CC1B1OC(C(O1)(C)C)(C)C)N1N=CC=C1
  5. 4-(1-methyl-1H-pyrazol-5-yl)phenol

    CAS No.: 1206970-50-4
    Catalog No.: TQR0202
    Purity: 95%
    MF: C10H10N2O
    MW: 174.203
    Storage: 2-8 degree Celsius
    SMILES: CN1N=CC=C1C1=CC=C(C=C1)O
  6. 1-phenyl-3-(2,4,5-trimethylphenyl)-1H-pyrazol-5-amine

    CAS No.: 882229-28-9
    Catalog No.: TQR0240
    Purity: 95%
    MF: C18H19N3
    MW: 277.371
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)N1N=C(C=C1N)C1=C(C=C(C(=C1)C)C)C
  7. 4-(3,5-bis(trifluoromethyl)-1H-pyrazol-1-yl)aniline

    CAS No.: 123066-64-8
    Catalog No.: TQR0359
    Purity: 95%
    MF: C11H7F6N3
    MW: 295.186
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NN(C(=C1)C(F)(F)F)C1=CC=C(N)C=C1)(F)F
  8. 1-(4-bromophenyl)-3,5-bis(trifluoromethyl)-1H-pyrazole

    CAS No.: 1315322-98-5
    Catalog No.: TQR0361
    Purity: 95%
    MF: C11H5BrF6N2
    MW: 359.067
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)N1N=C(C=C1C(F)(F)F)C(F)(F)F
  9. 1-(4-ethynylphenyl)-3,5-bis(trifluoromethyl)-1H-pyrazole

    CAS No.: 2169316-37-2
    Catalog No.: TQR0362
    Purity: 95%
    MF: C13H6F6N2
    MW: 304.193
    Storage: 2-8 degree Celsius
    SMILES: C(#C)C1=CC=C(C=C1)N1N=C(C=C1C(F)(F)F)C(F)(F)F
  10. ethyl 1-(4-aminophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate

    CAS No.: 223500-15-0
    Catalog No.: TQR0363
    Purity: 95%
    MF: C13H12F3N3O2
    MW: 299.252
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=C1)N1N=CC(=C1C(F)(F)F)C(=O)OCC
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 842 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7