•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazines

Set Ascending Direction

   

Items 21 to 30 of 265 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (E)-3-(pyrazin-2-yl)acrylic acid

    CAS No.: 123530-66-5
    Catalog No.: 103468
    Purity: 95%
    MF: C7H6N2O2
    MW: 150.137
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C\C1=NC=CN=C1
  2. 6-bromo-3-oxo-3,4-dihydropyrazine-2-carboxamide

    CAS No.: 259793-88-9
    Catalog No.: 106567
    Purity: 95%
    MF: C5H4BrN3O2
    MW: 218.01
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=NC(Br)=CNC1=O
  3. tert-butyl (5-methylpyrazin-2-yl)carbamate

    CAS No.: 369638-68-6
    Catalog No.: 106787
    Purity: 95%
    MF: C10H15N3O2
    MW: 209.249
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN=C(NC(=O)OC(C)(C)C)C=N1
  4. 2-(piperazin-1-yl)pyrazine

    CAS No.: 34803-68-4
    Catalog No.: 107784
    Purity: 95%
    MF: C8H12N4
    MW: 164.212
    Storage: 2-8 degree Celsius
    SMILES: C1CN(CCN1)C1=NC=CN=C1
  5. 2-(chloromethyl)pyrazine hydrochloride

    CAS No.: 210037-98-2
    Catalog No.: 125218
    Purity: 95%
    MF: C5H6Cl2N2
    MW: 165.023
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].ClCC1=NC=CN=C1
  6. 5-bromo-3-ethynylpyrazin-2-amine

    CAS No.: 1209289-08-6
    Catalog No.: 126191
    Purity: 95%
    MF: C6H4BrN3
    MW: 198.023
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Br)N=C1C#C
  7. 3-chloro-5-iodo-N-methylpyrazin-2-amine

    CAS No.: 1704064-40-3
    Catalog No.: 127186
    Purity: 95%
    MF: C5H5ClIN3
    MW: 269.473
    Storage: 2-8 degree Celsius
    SMILES: CNC1=C(Cl)N=C(I)C=N1
  8. 5-chloropyrazin-2-amine

    CAS No.: 33332-29-5
    Catalog No.: 132444
    Purity: 95%
    MF: C4H4ClN3
    MW: 129.55
    Storage: 2-8 degree Celsius
    SMILES: NC1=CN=C(Cl)C=N1
  9. 3,5-dibromopyrazin-2-amine

    CAS No.: 24241-18-7
    Catalog No.: 132456
    Purity: 95%
    MF: C4H3Br2N3
    MW: 252.897
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(Br)N=C(Br)C=N1
  10. 5-bromo-2-chloropyrazine

    CAS No.: 912773-21-8
    Catalog No.: 146002
    Purity: 95%
    MF: C4H2BrClN2
    MW: 193.431
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CN=C(Br)C=N1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 265 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5