•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Purines

Set Ascending Direction

   

Items 1 to 10 of 114 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 3-(6-chloro-9H-purin-9-yl)azetidine-1-carboxylate

    CAS No.: 2137735-36-3
    Catalog No.: TQR1097
    Purity: 95%
    MF: C13H16ClN5O2
    MW: 309.757
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC=N1)C1CN(C1)C(=O)OC(C)(C)C
  2. tert-butyl 3-(6-chloro-2-methyl-9H-purin-9-yl)azetidine-1-carboxylate

    CAS No.: 2423059-01-0
    Catalog No.: TQR1098
    Purity: 95%
    MF: C14H18ClN5O2
    MW: 323.784
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC(=N1)C)C1CN(C1)C(=O)OC(C)(C)C
  3. tert-butyl 3-(6-chloro-2-methyl-9H-purin-9-yl)-3-methylazetidine-1-carboxylate

    CAS No.: 2423059-03-2
    Catalog No.: TQR1099
    Purity: 95%
    MF: C15H20ClN5O2
    MW: 337.811
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC(=N1)C)C1(CN(C1)C(=O)OC(C)(C)C)C
  4. 9-(azetidin-3-yl)-9H-purin-6-amine dihydrochloride

    CAS No.: 2375273-16-6
    Catalog No.: TQR1100
    Purity: 95%
    MF: C8H12Cl2N6
    MW: 263.132
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1CC(C1)N1C2=NC=NC(=C2N=C1)N
  5. 9-(azetidin-3-yl)-9H-purin-6-amine hydrochloride

    CAS No.: 1864064-67-4
    Catalog No.: TQR1101
    Purity: 95%
    MF: C8H11ClN6
    MW: 226.671
    Storage: 2-8 degree Celsius
    SMILES: Cl.N1CC(C1)N1C2=NC=NC(=C2N=C1)N
  6. 2-chloro-9-(tetrahydro-2H-pyran-4-yl)-7H-purin-8(9H)-one

    CAS No.: 1299420-88-4
    Catalog No.: TQR1155
    Purity: 95%
    MF: C10H11ClN4O2
    MW: 254.677
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C2NC(N(C2=N1)C1CCOCC1)=O
  7. 2-chloro-9-cyclohexyl-7H-purin-8(9H)-one

    CAS No.: 1352623-69-8
    Catalog No.: TQR1156
    Purity: 95%
    MF: C11H13ClN4O
    MW: 252.705
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C2NC(N(C2=N1)C1CCCCC1)=O
  8. 2-chloro-9-methyl-7H-purin-8(9H)-one

    CAS No.: 1273315-11-9
    Catalog No.: TQR1157
    Purity: 95%
    MF: C6H5ClN4O
    MW: 184.586
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C2NC(N(C2=N1)C)=O
  9. (R)-2-chloro-9-(8-fluorochroman-4-yl)-7H-purin-8(9H)-one

    CAS No.: 1352623-78-9
    Catalog No.: TQR1158
    Purity: 95%
    MF: C14H10ClFN4O2
    MW: 320.711
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C2NC(N(C2=N1)[C@@H]1CCOC2=C(C=CC=C12)F)=O
  10. 2-chloro-9-phenyl-7H-purin-8(9H)-one

    CAS No.: 89660-30-0
    Catalog No.: TQR1159
    Purity: 95%
    MF: C11H7ClN4O
    MW: 246.657
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C2NC(N(C2=N1)C1=CC=CC=C1)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 114 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5