•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Protein Tyrosine Kinase

Set Ascending Direction

   

Items 51 to 60 of 106 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. Selpercatinib

    CAS No.: 2152628-33-4
    Catalog No.: ZB1574
    Purity: 95%
    MF: C29H31N7O3
    MW: 525.613
    Storage: 2-8 degree Celsius
    SMILES: OC(COC=1C=C(C=2N(C1)N=CC2C#N)C=2C=NC(=CC2)N2CC1N(C(C2)C1)CC=1C=NC(=CC1)OC)(C)C
  2. PLX5622

    CAS No.: 1303420-67-8
    Catalog No.: ZB1607
    Purity: 95%
    MF: C21H19F2N5O
    MW: 395.413
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=CC(=N1)NCC=1C(=NC=C(C1)F)OC)CC1=CNC2=NC=C(C=C21)C
  3. Afatinib; BIBW2992

    CAS No.: 850140-72-6
    Catalog No.: 100723
    Purity: 95%
    MF: C24H25ClFN5O3
    MW: 485.947
    Storage: 2-8 degree Celsius
    SMILES: CN(C)C\C=C\C(=O)NC1=CC2=C(NC3=CC=C(F)C(Cl)=C3)N=CN=C2C=C1O[C@H]1CCOC1
  4. Nintedanib; BIBF 1120; BIBF-1120; Vargatef

    CAS No.: 656247-17-5
    Catalog No.: 100837
    Purity: 95%
    MF: C31H33N5O4
    MW: 539.636
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC2=C(C=C1)\C(=C(\NC1=CC=C(C=C1)N(C)C(=O)CN1CCN(C)CC1)C1=CC=CC=C1)C(=O)N2
  5. GW441756; GW 441756

    CAS No.: 504433-23-2
    Catalog No.: 100878
    Purity: 95%
    MF: C17H13N3O
    MW: 275.311
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(\C=C2/C(=O)NC3=CC=CN=C23)C2=C1C=CC=C2
  6. LY2874455

    CAS No.: 1254473-64-7
    Catalog No.: 100944
    Purity: 95%
    MF: C21H19Cl2N5O2
    MW: 444.322
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](OC1=CC2=C(NN=C2\C=C\C2=CN(CCO)N=C2)C=C1)C1=C(Cl)C=NC=C1Cl
  7. Alectinib; CH5424802

    CAS No.: 1256580-46-7
    Catalog No.: 100947
    Purity: 95%
    MF: C30H34N4O2
    MW: 482.628
    Storage: 2-8 degree Celsius
    SMILES: CCC1=C(C=C2C(=C1)C(=O)C1=C(NC3=C1C=CC(=C3)C#N)C2(C)C)N1CCC(CC1)N1CCOCC1
  8. Cediranib; AZD2171

    CAS No.: 288383-20-0
    Catalog No.: 100956
    Purity: 95%
    MF: C25H27FN4O3
    MW: 450.514
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(OC3=C(F)C4=C(NC(C)=C4)C=C3)N=CN=C2C=C1OCCCN1CCCC1
  9. Vandetanib; ZD6474

    CAS No.: 443913-73-3
    Catalog No.: 100965
    Purity: 95%
    MF: C22H24BrFN4O2
    MW: 475.362
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC3=CC=C(Br)C=C3F)N=CN=C2C=C1OCC1CCN(C)CC1
  10. Crizotinib; PF-02341066

    CAS No.: 877399-52-5
    Catalog No.: 100966
    Purity: 95%
    MF: C21H22Cl2FN5O
    MW: 450.345
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](OC1=CC(=CN=C1N)C1=CN(N=C1)C1CCNCC1)C1=C(Cl)C=CC(F)=C1Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 106 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8