•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Protein Tyrosine Kinase

Set Ascending Direction

   

Items 31 to 40 of 106 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. AMG-208

    CAS No.: 1002304-34-8
    Catalog No.: 104824
    Purity: 95%
    MF: C22H17N5O2
    MW: 383.411
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C(OCC3=NN=C4C=CC(=NN34)C3=CC=CC=C3)=CC=NC2=C1
  2. SB505124

    CAS No.: 694433-59-5
    Catalog No.: 104919
    Purity: 95%
    MF: C20H21N3O2
    MW: 335.407
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=CC(=N1)C1=C(N=C(N1)C(C)(C)C)C1=CC=C2OCOC2=C1
  3. Regorafenib Hydrochloride

    CAS No.: 835621-07-3
    Catalog No.: 112907
    Purity: 95%
    MF: C21H16Cl2F4N4O3
    MW: 519.282
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC=C(Cl)C(=C3)C(F)(F)F)C(F)=C2)=C1
  4. Afatinib dimaleate

    CAS No.: 850140-73-7
    Catalog No.: 133153
    Purity: 95%
    MF: C32H33ClFN5O11
    MW: 718.091
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.CN(C)C\C=C\C(=O)NC1=CC2=C(NC3=CC=C(F)C(Cl)=C3)N=CN=C2C=C1O[C@H]1CCOC1
  5. Toceranib phosphate

    CAS No.: 874819-74-6
    Catalog No.: 154994
    Purity: 95%
    MF: C22H28FN4O6P
    MW: 494.46
    Storage: 2-8 degree Celsius
    SMILES: OP(O)(O)=O.CC1=C(C(=O)NCCN2CCCC2)C(C)=C(N1)\C=C1/C(=O)NC2=C1C=C(F)C=C2
  6. N-(3-((5-chloro-2-((2-methoxy-4-(piperazin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)acrylamide

    CAS No.: NA
    Catalog No.: 136011
    Purity: 95%
    MF: C24H25ClN6O3
    MW: 480.956
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(NC2=NC(OC3=CC=CC(NC(=O)C=C)=C3)=C(Cl)C=N2)C=CC(=C1)N1CCNCC1
  7. Pirtobrutinib (LOXO-305)

    CAS No.: 2101700-15-4
    Catalog No.: 190789
    Purity: 95%
    MF: C22H21F4N5O3
    MW: 479.434
    Storage: 2-8 degree Celsius
    SMILES: O=C(C1=C(N)N([C@@H](C)C(F)(F)F)N=C1C2=CC=C(CNC(C3=CC(F)=CC=C3OC)=O)C=C2)N
  8. TQB3804 (EGFR-IN-7)

    CAS No.: 2267329-76-8
    Catalog No.: 193439
    Purity: 95%
    MF: C32H41BrN9O2P
    MW: 694.619
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC(=NC1)NC1=C(C=C(C(=C1)C)N1CCC(CC1)N1CCN(CC1)C)OC)NC=1C(=C2N=CC=NC2=CC1)P(C)(C)=O
  9. Pimicotinib

    CAS No.: 2253123-16-7
    Catalog No.: 198547
    Purity: 95%
    MF: C22H24N6O3
    MW: 420.473
    Storage: 2-8 degree Celsius
    SMILES: CC1(C(N(CC1)C(=O)NC1=NC(=C(C=C1)OC1=CC(=NC=C1)C=1C=NN(C1)C)C)=O)C
  10. AP26113; Brigatinib

    CAS No.: 1197953-54-0
    Catalog No.: 140455
    Purity: 95%
    MF: C29H39ClN7O2P
    MW: 584.105
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(=CC=C1NC1=NC=C(Cl)C(NC2=CC=CC=C2P(C)(C)=O)=N1)N1CCC(CC1)N1CCN(C)CC1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 106 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6