•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PI3K/Akt/mTOR

Set Ascending Direction

   

Items 11 to 20 of 57 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Ipatasertib; GDC-0068

    CAS No.: 1001264-89-6
    Catalog No.: 104905
    Purity: 95%
    MF: C24H32ClN5O2
    MW: 458.006
    Storage: 2-8 degree Celsius
    SMILES: CC(C)NC[C@@H](C(=O)N1CCN(CC1)C1=C2[C@H](C)C[C@@H](O)C2=NC=N1)C1=CC=C(Cl)C=C1
  2. Duvelisib; IPI-145; INK1197

    CAS No.: 1201438-56-3
    Catalog No.: 105143
    Purity: 95%
    MF: C22H17ClN6O
    MW: 416.872
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC1=C2N=CNC2=NC=N1)C1=CC2=C(C(Cl)=CC=C2)C(=O)N1C1=CC=CC=C1
  3. Pictilisib; GDC-0941; GDC0941

    CAS No.: 957054-30-7
    Catalog No.: 105145
    Purity: 95%
    MF: C23H27N7O3S2
    MW: 513.649
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)N1CCN(CC2=CC3=NC(=NC(N4CCOCC4)=C3S2)C2=CC=CC3=C2C=NN3)CC1
  4. AZD5363

    CAS No.: 1143532-39-1
    Catalog No.: 109728
    Purity: 95%
    MF: C21H25ClN6O2
    MW: 428.924
    Storage: 2-8 degree Celsius
    SMILES: NC1(CCN(CC1)C1=C2C=CNC2=NC=N1)C(=O)N[C@@H](CCO)C1=CC=C(Cl)C=C1
  5. BI-D1870

    CAS No.: 501437-28-1
    Catalog No.: 109735
    Purity: 95%
    MF: C19H23F2N5O2
    MW: 391.422
    Storage: 2-8 degree Celsius
    SMILES: CC(C)CCN1C(C)C(=O)N(C)C2=CN=C(NC3=CC(F)=C(O)C(F)=C3)N=C12
  6. CH5132799; CH 5132799

    CAS No.: 1007207-67-1
    Catalog No.: 100843
    Purity: 95%
    MF: C15H19N7O3S
    MW: 377.43
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)N1CCC2=C(N=C(N=C12)N1CCOCC1)C1=CN=C(N)N=C1
  7. OSI-027

    CAS No.: 936890-98-1
    Catalog No.: 109796
    Purity: 95%
    MF: C21H22N6O3
    MW: 406.446
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=CC2=C1NC(=C2)C1=C2N(N=CN=C2N)C(=N1)[C@H]1CC[C@@H](CC1)C(O)=O
  8. Torin 1

    CAS No.: 1222998-36-8
    Catalog No.: 109828
    Purity: 95%
    MF: C35H28F3N5O2
    MW: 607.636
    Storage: 2-8 degree Celsius
    SMILES: CCC(=O)N1CCN(CC1)C1=CC=C(C=C1C(F)(F)F)N1C(=O)C=CC2=C1C1=CC(=CC=C1N=C2)C1=CC2=CC=CC=C2N=C1
  9. PIK-93

    CAS No.: 593960-11-3
    Catalog No.: 111928
    Purity: 95%
    MF: C14H16ClN3O4S2
    MW: 389.886
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)NC1=NC(C)=C(S1)C1=CC=C(Cl)C(=C1)S(=O)(=O)NCCO
  10. GNE-477

    CAS No.: 1032754-81-6
    Catalog No.: 112432
    Purity: 95%
    MF: C21H28N8O3S2
    MW: 504.642
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(CN2CCN(CC2)S(C)(=O)=O)SC2=C(N=C(N=C12)C1=CN=C(N)N=C1)N1CCOCC1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 57 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5