•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Others

Set Descending Direction

   

Items 21 to 30 of 3418 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4,4'-((2-(tert-butoxy)-2-oxoethyl)azanediyl)bis(2-(((benzyloxy)carbonyl)amino)-2-methylbutanoic acid)

    CAS No.: 1426654-39-8
    Catalog No.: 100519
    Purity: 95%
    MF: C32H43N3O10
    MW: 629.707
    Storage: 2-8 degree Celsius
  2. Brusatol

    CAS No.: 14907-98-3
    Catalog No.: 100935
    Purity: 95%
    MF: C26H32O11
    MW: 520.531
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12[C@@H](OC(=O)C=C(C)C)C(=O)O[C@]3([H])C[C@@]4([H])C(C)=C(O)C(=O)C[C@]4(C)[C@@]4([H])[C@@H](O)[C@H](O)[C@]1(OC[C@@]234)C(=O)OC
  3. CID-1067700; CID 1067700

    CAS No.: 314042-01-8
    Catalog No.: 100833
    Purity: 95%
    MF: C18H18N2O4S2
    MW: 390.486
    Storage: 2-8 degree Celsius
  4. ML213; ML-213; ML 213

    CAS No.: 489402-47-3
    Catalog No.: 100846
    Purity: 95%
    MF: C17H23NO
    MW: 257.377
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(C)=C(NC(=O)C2CC3CCC2C3)C(C)=C1
  5. PGMI-004A

    CAS No.: 1313738-90-7
    Catalog No.: 100885
    Purity: 95%
    MF: C21H12F3NO6S
    MW: 463.389
    Storage: 2-8 degree Celsius
  6. Tigecycline; GAR-936

    CAS No.: 220620-09-7
    Catalog No.: 101150
    Purity: 95%
    MF: C29H39N5O8
    MW: 585.658
    Storage: 2-8 degree Celsius
  7. 1-NA-PP1; 1-Naphthyl PP1 hydrochloride

    CAS No.: 956025-47-1
    Catalog No.: 100671
    Purity: 95%
    MF: C19H20ClN5
    MW: 353.857
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CC(C)(C)N1N=C(C2=C(N)N=CN=C12)C1=C2C=CC=CC2=CC=C1
  8. Ac-Ala-MCA

    CAS No.: 355137-87-0
    Catalog No.: 100597
    Purity: 95%
    MF: C15H16N2O4
    MW: 288.303
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(C)=O)C(=O)NC1=CC2=C(C=C1)C(C)=CC(=O)O2
  9. Cbz-FTY720

    CAS No.: 402616-41-5
    Catalog No.: 100720
    Purity: 95%
    MF: C27H39NO4
    MW: 441.612
    Storage: 2-8 degree Celsius
    SMILES: CCCCCCCCC1=CC=C(CCC(CO)(CO)NC(=O)OCC2=CC=CC=C2)C=C1
  10. Finafloxacin

    CAS No.: 209342-40-5
    Catalog No.: 100827
    Purity: 95%
    MF: C20H19FN4O4
    MW: 398.394
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12CN(C[C@]1([H])OCCN2)C1=C(C#N)C2=C(C=C1F)C(=O)C(=CN2C1CC1)C(O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 3418 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5