•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Others

Set Ascending Direction

   

Items 11 to 20 of 3418 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-(2-(2-(4-methoxyphenyl)propan-2-yl)pyridin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-70-2
    Catalog No.: 100445
    Purity: 95%
    MF: C19H21N3OS
    MW: 339.464
    Storage: 2-8 degree Celsius
  2. 5-(2-(2-(4-methoxyphenyl)propan-2-yl)pyridin-4-yl)thiazol-2-amine

    CAS No.: 1395492-62-2
    Catalog No.: 100464
    Purity: 95%
    MF: C18H19N3OS
    MW: 325.437
    Storage: 2-8 degree Celsius
  3. 5-(2-(1-(4-methoxyphenyl)cyclopropyl)pyridin-4-yl)thiazol-2-amine

    CAS No.: 1395492-55-3
    Catalog No.: 100465
    Purity: 95%
    MF: C18H17N3OS
    MW: 323.421
    Storage: 2-8 degree Celsius
  4. 5-(2-benzylpyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-07-4
    Catalog No.: 100469
    Purity: 95%
    MF: C15H14N4S
    MW: 282.372
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(CC2=CC=CC=C2)=NC=C1
  5. 5-(2-(2,6-dichlorobenzyl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1163706-69-1
    Catalog No.: 100472
    Purity: 95%
    MF: C15H12Cl2N4S
    MW: 351.262
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(CC2=C(Cl)C=CC=C2Cl)=NC=C1
  6. 5-(2-((4-methoxyphenoxy)methyl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-16-5
    Catalog No.: 100474
    Purity: 95%
    MF: C16H16N4O2S
    MW: 328.397
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(OCC2=NC=CC(=N2)C2=C(C)N=C(N)S2)C=C1
  7. 5-(2-(2-fluorophenyl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-21-2
    Catalog No.: 100475
    Purity: 95%
    MF: C14H11FN4S
    MW: 286.335
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(=NC=C1)C1=CC=CC=C1F
  8. 5-(2-(2-(4-methoxyphenyl)propan-2-yl)pyrimidin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1217487-31-4
    Catalog No.: 100478
    Purity: 95%
    MF: C18H20N4OS
    MW: 340.452
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1)C(C)(C)C1=NC=CC(=N1)C1=C(C)N=C(N)S1
  9. 4-methyl-5-(2-(2-p-tolylpropan-2-yl)pyrimidin-4-yl)thiazol-2-amine

    CAS No.: 1217487-36-9
    Catalog No.: 100480
    Purity: 95%
    MF: C18H20N4S
    MW: 324.453
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(=NC=C1)C(C)(C)C1=CC=C(C)C=C1
  10. 4-methyl-5-(2-(1-phenylcyclopentyl)pyrimidin-4-yl)thiazol-2-amine

    CAS No.: 1217487-38-1
    Catalog No.: 100481
    Purity: 95%
    MF: C19H20N4S
    MW: 336.464
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC(N)=N1)C1=NC(=NC=C1)C1(CCCC1)C1=CC=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 3418 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5