•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Neuronal Signaling

Set Descending Direction

   

Items 21 to 30 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Varenicline Tartrate; CP 526555-18; Champix tartrate; Chantix tartrate

    CAS No.: 375815-87-5
    Catalog No.: 112422
    Purity: 95%
    MF: C17H19N3O6
    MW: 361.354
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]([C@@H](O)C(O)=O)C(O)=O.C1C2CNCC1C1=C2C=C2N=CC=NC2=C1
  2. Dopamine HCl

    CAS No.: 62-31-7
    Catalog No.: 113742
    Purity: 95%
    MF: C8H12ClNO2
    MW: 189.642
    Storage: -20 degree Celsius
    SMILES: Cl[H].NCCC1=CC(O)=C(O)C=C1
  3. Indomethacin

    CAS No.: 53-86-1
    Catalog No.: 131734
    Purity: 95%
    MF: C19H16ClNO4
    MW: 357.793
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1)N(C(=O)C1=CC=C(Cl)C=C1)C(C)=C2CC(O)=O
  4. CH7057288

    CAS No.: 2095616-82-1
    Catalog No.: ZB1627
    Purity: 95%
    MF: C32H31N3O5S
    MW: 569.683
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)NC(C1=CC(=NC(=C1)C)C#CC1=CC2=C(C3=C(O2)C(C=2C=C(C=CC2C3=O)NS(=O)(=O)C)(C)C)C=C1)=O
  5. Rosmarinic acid

    CAS No.: 20283-92-5
    Catalog No.: ZB1872
    Purity: 95%
    MF: C18H16O8
    MW: 360.318
    Storage: 2-8 degree Celsius
    SMILES: OC=1C=C(C=CC1O)C[C@H](C(=O)O)OC(\C=C\C1=CC(=C(C=C1)O)O)=O
  6. Fluoxetine Hydrochloride

    CAS No.: 56296-78-7
    Catalog No.: 154061
    Purity: 95%
    MF: C17H19ClF3NO
    MW: 345.792
    Storage: 2-8 degree Celsius
    SMILES: Cl.CNCCC(OC1=CC=C(C=C1)C(F)(F)F)C1=CC=CC=C1
  7. Oxybutynin chloride

    CAS No.: 1508-65-2
    Catalog No.: 109904
    Purity: 95%
    MF: C22H32ClNO3
    MW: 393.955
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCN(CC)CC#CCOC(=O)C(O)(C1CCCCC1)C1=CC=CC=C1
  8. Ziprasidone hydrochloride monohydrate

    CAS No.: 138982-67-9
    Catalog No.: 112450
    Purity: 95%
    MF: C21H24Cl2N4O2S
    MW: 467.422
    Storage: 2-8 degree Celsius
    SMILES: O.Cl.S1N=C(C2=C1C=CC=C2)N2CCN(CC2)CCC=2C=C1CC(NC1=CC2Cl)=O
  9. Tetrahydrozoline HCl

    CAS No.: 522-48-5
    Catalog No.: 113820
    Purity: 95%
    MF: C13H17ClN2
    MW: 236.746
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C1CN=C(N1)C1CCCC2=C1C=CC=C2
  10. Aripiprazole

    CAS No.: 129722-12-9
    Catalog No.: 113822
    Purity: 95%
    MF: C23H27Cl2N3O2
    MW: 448.394
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(Cl)C(=CC=C1)N1CCN(CCCCOC2=CC3=C(CCC(=O)N3)C=C2)CC1
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5