•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Neuronal Signaling

Set Ascending Direction

   

Items 11 to 20 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Pramipexole

    CAS No.: 104632-26-0
    Catalog No.: 151693
    Purity: 95%
    MF: C10H17N3S
    MW: 211.334
    Storage: 2-8 degree Celsius
    SMILES: CCCN[C@H]1CCC2=C(C1)SC(N)=N2
  2. Scopolamine HBr

    CAS No.: 114-49-8
    Catalog No.: 151707
    Purity: 95%
    MF: C17H22BrNO4
    MW: 384.27
    Storage: 2-8 degree Celsius
    SMILES: Br[H].CN1[C@H]2C[C@@H](C[C@@H]1[C@H]1O[C@@H]21)OC(=O)[C@H](CO)C1=CC=CC=C1
  3. 5-hydroxymethyl Tolterodine; PNU 200577; 5-HMT; 5-HM

    CAS No.: 207679-81-0
    Catalog No.: 151756
    Purity: 95%
    MF: C22H31NO2
    MW: 341.495
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N(CC[C@H](C1=CC=CC=C1)C1=CC(CO)=CC=C1O)C(C)C
  4. Rotigotine

    CAS No.: 99755-59-6
    Catalog No.: 129742
    Purity: 95%
    MF: C19H25NOS
    MW: 315.482
    Storage: 2-8 degree Celsius
    SMILES: CCCN(CCC1=CC=CS1)[C@H]1CCC2=C(C1)C=CC=C2O
  5. Serotonin HCl

    CAS No.: 153-98-0
    Catalog No.: 151917
    Purity: 95%
    MF: C10H13ClN2O
    MW: 212.68
    Storage: -20 degree Celsius
    SMILES: Cl.NCCC1=CNC2=CC=C(O)C=C12
  6. PF-03084014; PF-3084014

    CAS No.: 1290543-63-3
    Catalog No.: 152149
    Purity: 95%
    MF: C27H41F2N5O
    MW: 489.655
    Storage: 2-8 degree Celsius
    SMILES: CCC[C@H](N[C@H]1CCC2=C(C1)C(F)=CC(F)=C2)C(=O)NC1=CN(C=N1)C(C)(C)CNCC(C)(C)C
  7. Lornoxicam

    CAS No.: 70374-39-9
    Catalog No.: 158602
    Purity: 95%
    MF: C13H10ClN3O4S2
    MW: 371.827
    Storage: 2-8 degree Celsius
    SMILES: CN1C(C(=O)NC2=NC=CC=C2)=C(O)C2=C(C=C(Cl)S2)S1(=O)=O
  8. Scopolamine HBr trihydrate

    CAS No.: 6533-68-2
    Catalog No.: 191512
    Purity: 95%
    MF: C17H28BrNO7
    MW: 438.315
    Storage: 2-8 degree Celsius
    SMILES: [C@]([H])12O[C@@]1([H])[C@]([H])1N(C)[C@]2([H])C[C@@H](OC(=O)[C@H](CO)C2C=CC=CC=2)C1.O.O.O.Br
  9. Zolmitriptan

    CAS No.: 139264-17-8
    Catalog No.: 109897
    Purity: 95%
    MF: C16H21N3O2
    MW: 287.363
    Storage: 2-8 degree Celsius
    SMILES: CN(C)CCC1=CNC2=C1C=C(C[C@H]1COC(=O)N1)C=C2
  10. Celecoxib; Celebra; Celebrex; SC 58635

    CAS No.: 169590-42-5
    Catalog No.: 112408
    Purity: 95%
    MF: C17H14F3N3O2S
    MW: 381.379
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)C1=CC(=NN1C1=CC=C(C=C1)S(N)(=O)=O)C(F)(F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5