•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Naphthalenes

Set Ascending Direction

   

Items 31 to 40 of 245 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 6-iodo-3,4-dihydronaphthalen-1(2H)-one

    CAS No.: 340825-13-0
    Catalog No.: 125364
    Purity: 95%
    MF: C10H9IO
    MW: 272.085
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC2=C(C=C1)C(=O)CCC2
  2. 4-fluorobenzene-1,3-diol

    CAS No.: 103068-41-3
    Catalog No.: 126620
    Purity: 95%
    MF: C6H5FO2
    MW: 128.102
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=C(F)C(O)=C1
  3. 2-nitronaphthalen-1-ol

    CAS No.: 607-24-9
    Catalog No.: 131928
    Purity: 95%
    MF: C10H7NO3
    MW: 189.17
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=CC2=CC=CC=C12)[N+]([O-])=O
  4. 2-aminonaphthalen-1-ol

    CAS No.: 606-41-7
    Catalog No.: 131929
    Purity: 95%
    MF: C10H9NO
    MW: 159.188
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(O)C2=CC=CC=C2C=C1
  5. 2,7-dibromonaphthalene

    CAS No.: 58556-75-5
    Catalog No.: 133404
    Purity: 95%
    MF: C10H6Br2
    MW: 285.966
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=CC(Br)=CC=C2C=C1
  6. 6-bromo-1-hydroxynaphthalene

    CAS No.: 91270-68-7
    Catalog No.: 134093
    Purity: 95%
    MF: C10H7BrO
    MW: 223.069
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=CC2=CC(Br)=CC=C12
  7. N-phenethylnaphthalene-2-sulfonamide

    CAS No.: 75115-36-5
    Catalog No.: 135233
    Purity: 95%
    MF: C18H17NO2S
    MW: 311.406
    Storage: 2-8 degree Celsius
    SMILES: O=S(=O)(NCCC1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1
  8. 1-cyclopropylnaphthalene

    CAS No.: 25033-19-6
    Catalog No.: 135366
    Purity: 95%
    MF: C13H12
    MW: 168.239
    Storage: 2-8 degree Celsius
    SMILES: C1CC1C1=CC=CC2=CC=CC=C12
  9. 1-cyclohexene-1-carboxylic acid

    CAS No.: 636-82-8
    Catalog No.: 135374
    Purity: 95%
    MF: C7H10O2
    MW: 126.155
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CCCCC1
  10. 4-chloronaphthalene-1-boronic acid

    CAS No.: 147102-97-4
    Catalog No.: 142826
    Purity: 95%
    MF: C10H8BClO2
    MW: 206.437
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=CC=C(Cl)C2=CC=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 245 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6