•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Naphthalenes

Set Ascending Direction

   

Items 21 to 30 of 245 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 7-bromo-3-hydroxy-2-naphthoic acid

    CAS No.: 1779-11-9
    Catalog No.: 108135
    Purity: 95%
    MF: C11H7BrO3
    MW: 267.078
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=C(O)C=C2C=CC(Br)=CC2=C1
  2. N1-(naphthalen-1-yl)ethane-1,2-diamine

    CAS No.: 551-09-7
    Catalog No.: 108182
    Purity: 95%
    MF: C12H14N2
    MW: 186.258
    Storage: 2-8 degree Celsius
    SMILES: NCCNC1=C2C=CC=CC2=CC=C1
  3. naphthalen-1-ylmethanamine

    CAS No.: 118-31-0
    Catalog No.: 108189
    Purity: 95%
    MF: C11H11N
    MW: 157.216
    Storage: 2-8 degree Celsius
    SMILES: NCC1=C2C=CC=CC2=CC=C1
  4. 2-(7-methoxy-1-naphthyl)ethylamine hydrochloride

    CAS No.: 139525-77-2
    Catalog No.: 109954
    Purity: 95%
    MF: C13H16ClNO
    MW: 237.73
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].COC1=CC2=C(CCN)C=CC=C2C=C1
  5. 3-bromoperylene

    CAS No.: 23683-68-3
    Catalog No.: 110321
    Purity: 95%
    MF: C20H11Br
    MW: 331.212
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C3=CC=CC4=C3C(=CC=C4)C3=C2C1=CC=C3
  6. 1,8-naphthalenediyl dibenzoate

    CAS No.: 331711-99-0
    Catalog No.: 110332
    Purity: 95%
    MF: C24H16O4
    MW: 368.388
    Storage: 2-8 degree Celsius
    SMILES: O=C(OC1=CC=CC2=CC=CC(OC(=O)C3=CC=CC=C3)=C12)C1=CC=CC=C1
  7. 4,4,5,5-tetramethyl-2-(perylen-3-yl)-1,3,2-dioxaborolane

    CAS No.: 950761-81-6
    Catalog No.: 110336
    Purity: 95%
    MF: C26H23BO2
    MW: 378.28
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CC=C2C3=CC=CC4=C3C(=CC=C4)C3=C2C1=CC=C3
  8. 6-fluoro-3,4-dihydronaphthalen-2(1H)-one

    CAS No.: 29419-14-5
    Catalog No.: 111204
    Purity: 95%
    MF: C10H9FO
    MW: 164.179
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(CC(=O)CC2)C=C1
  9. 5-oxo-5,6,7,8-tetrahydronaphthalene-2-carbonitrile

    CAS No.: 90401-84-6
    Catalog No.: 125192
    Purity: 95%
    MF: C11H9NO
    MW: 171.199
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCCC2=CC(=CC=C12)C#N
  10. 6-amino-3,4-dihydronaphthalen-1(2H)-one

    CAS No.: 3470-53-9
    Catalog No.: 125349
    Purity: 95%
    MF: C10H11NO
    MW: 161.204
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC2=C(C=C1)C(=O)CCC2
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 245 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5